The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-(4-chloro-1,3-dioxoisoindolin-2-yl)-2,3,5-trifluorophenyl]-3-methylfuran-2-carboxamide ID: ALA4787053
PubChem CID: 162667269
Max Phase: Preclinical
Molecular Formula: C20H10ClF3N2O4
Molecular Weight: 434.76
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccoc1C(=O)Nc1cc(F)c(N2C(=O)c3cccc(Cl)c3C2=O)c(F)c1F
Standard InChI: InChI=1S/C20H10ClF3N2O4/c1-8-5-6-30-17(8)18(27)25-12-7-11(22)16(15(24)14(12)23)26-19(28)9-3-2-4-10(21)13(9)20(26)29/h2-7H,1H3,(H,25,27)
Standard InChI Key: PKLJSDSDRYJRNX-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
5.8799 -13.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8787 -14.0101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5909 -14.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3047 -14.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3019 -13.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5891 -12.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5867 -11.9563 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1666 -14.4223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4551 -14.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7429 -14.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4557 -13.1877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9959 -14.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4486 -14.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8567 -15.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6602 -15.2402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8263 -13.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1726 -12.7771 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0134 -14.4165 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0075 -12.7707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7536 -13.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0868 -11.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8852 -11.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2959 -12.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1105 -12.4883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5154 -11.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0998 -11.0732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2865 -11.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4761 -11.4174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9264 -13.9008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8724 -10.3759 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
2 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 10 1 0
12 16 1 0
1 17 1 0
4 18 1 0
5 19 1 0
19 20 1 0
20 23 1 0
22 21 1 0
21 19 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
20 29 2 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.76Molecular Weight (Monoisotopic): 434.0281AlogP: 4.71#Rotatable Bonds: 3Polar Surface Area: 79.62Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.61CX Basic pKa: ┄CX LogP: 4.27CX LogD: 4.27Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -1.36
References 1. Davis DC,Bungard JD,Chang S,Rodriguez AL,Blobaum AL,Boutaud O,Melancon BJ,Niswender CM,Jeffrey Conn P,Lindsley CW. (2021) Lead optimization of the VU0486321 series of mGlu PAMs. Part 4: SAR reveals positive cooperativity across multiple mGlu receptor subtypes leading to subtype unselective PAMs., 32 [PMID:33253881 ] [10.1016/j.bmcl.2020.127724 ]