3-(2,4-dimethoxyphenyl)-5-methylthiazolo[4,5-d]pyrimidine-2,7(3H,6H)-dione

ID: ALA4787090

PubChem CID: 155812457

Max Phase: Preclinical

Molecular Formula: C14H13N3O4S

Molecular Weight: 319.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2c(=O)sc3c(=O)[nH]c(C)nc32)c(OC)c1

Standard InChI:  InChI=1S/C14H13N3O4S/c1-7-15-12-11(13(18)16-7)22-14(19)17(12)9-5-4-8(20-2)6-10(9)21-3/h4-6H,1-3H3,(H,15,16,18)

Standard InChI Key:  NTXAZNYXWMHUBV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    6.4002  -14.4296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4002  -15.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1122  -15.6630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1122  -14.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8243  -14.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8287  -15.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6115  -15.5007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0907  -14.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6041  -14.1715    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6863  -15.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1122  -13.1879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9157  -14.8288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8700  -16.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3195  -16.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5781  -17.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3868  -17.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9364  -17.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6749  -16.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2218  -15.8307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0302  -15.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6471  -18.6325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0993  -19.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  2 10  1  0
  4 11  2  0
  8 12  2  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  7 13  1  0
 18 19  1  0
 19 20  1  0
 16 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4787090

    ---

Associated Targets(Human)

HOP-92 (41141 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IGROV-1 (47897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.34Molecular Weight (Monoisotopic): 319.0627AlogP: 1.46#Rotatable Bonds: 3
Polar Surface Area: 86.21Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.92CX Basic pKa: CX LogP: 1.18CX LogD: 1.08
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.79Np Likeness Score: -1.28

References

1. Mohamed SH,Elgiushy HR,Taha H,Hammad SF,Abou-Taleb NA,A M Abouzid K,Al-Sawaf H,Hassan Z.  (2020)  An investigative study of antitumor properties of a novel thiazolo[4,5-d]pyrimidine small molecule revealing superior antitumor activity with CDK1 selectivity and potent pro-apoptotic properties.,  28  (17): [PMID:32773088] [10.1016/j.bmc.2020.115633]

Source