The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-Acetylamino-3-[5-(4-trifluoromethyl-phenyl)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylsulfanyl]-propionic acid ID: ALA4787200
PubChem CID: 162667274
Max Phase: Preclinical
Molecular Formula: C27H24F3NO3S
Molecular Weight: 499.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)O
Standard InChI: InChI=1S/C27H24F3NO3S/c1-17(32)31-24(25(33)34)16-35-26(20-12-14-21(15-13-20)27(28,29)30)22-8-4-2-6-18(22)10-11-19-7-3-5-9-23(19)26/h2-9,12-15,24H,10-11,16H2,1H3,(H,31,32)(H,33,34)/t24-/m0/s1
Standard InChI Key: KEUGGLRLWJAVDO-DEOSSOPVSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
31.6327 -11.6909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3356 -12.1165 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.3566 -11.2917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.0620 -8.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6306 -9.4950 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.4553 -9.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6968 -6.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5177 -6.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3265 -8.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1672 -7.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3862 -7.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7636 -7.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9274 -8.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7083 -8.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0164 -7.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8146 -8.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4080 -9.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2034 -8.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4022 -7.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8073 -7.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8059 -9.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3744 -10.1762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5497 -10.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7677 -10.9015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1564 -9.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1183 -10.8573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0204 -10.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4129 -10.9438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2385 -10.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6699 -10.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2748 -9.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2023 -12.3947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.3362 -11.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7295 -12.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5115 -11.5826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 1 0
4 6 1 0
7 8 1 0
8 15 1 0
7 10 1 0
16 4 1 0
9 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
21 22 1 0
22 23 1 0
22 24 1 6
23 25 2 0
23 26 1 0
6 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 6 1 0
29 1 1 0
1 32 1 0
24 33 1 0
33 34 1 0
33 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.55Molecular Weight (Monoisotopic): 499.1429AlogP: 5.42#Rotatable Bonds: 6Polar Surface Area: 66.40Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.85CX Basic pKa: ┄CX LogP: 5.96CX LogD: 2.72Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -0.08
References 1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A. (2021) Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein., 215 [PMID:33640763 ] [10.1016/j.ejmech.2021.113288 ]