(R)-2-Acetylamino-3-[5-(4-trifluoromethyl-phenyl)-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylsulfanyl]-propionic acid

ID: ALA4787200

PubChem CID: 162667274

Max Phase: Preclinical

Molecular Formula: C27H24F3NO3S

Molecular Weight: 499.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)O

Standard InChI:  InChI=1S/C27H24F3NO3S/c1-17(32)31-24(25(33)34)16-35-26(20-12-14-21(15-13-20)27(28,29)30)22-8-4-2-6-18(22)10-11-19-7-3-5-9-23(19)26/h2-9,12-15,24H,10-11,16H2,1H3,(H,31,32)(H,33,34)/t24-/m0/s1

Standard InChI Key:  KEUGGLRLWJAVDO-DEOSSOPVSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   31.6327  -11.6909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3356  -12.1165    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.3566  -11.2917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.0620   -8.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6306   -9.4950    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.4553   -9.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6968   -6.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5177   -6.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3265   -8.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1672   -7.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3862   -7.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7636   -7.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9274   -8.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7083   -8.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0164   -7.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8146   -8.4567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4080   -9.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2034   -8.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4022   -7.9968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8073   -7.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8059   -9.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3744  -10.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5497  -10.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7677  -10.9015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1564   -9.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1183  -10.8573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0204  -10.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4129  -10.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2385  -10.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6699  -10.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2748   -9.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2023  -12.3947    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.3362  -11.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7295  -12.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5115  -11.5826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  7  8  1  0
  8 15  1  0
  7 10  1  0
 16  4  1  0
  9  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  6
 23 25  2  0
 23 26  1  0
  6 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  6  1  0
 29  1  1  0
  1 32  1  0
 24 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4787200

    ---

Associated Targets(Human)

KIF11 Tchem Kinesin-like protein 1 (1720 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.55Molecular Weight (Monoisotopic): 499.1429AlogP: 5.42#Rotatable Bonds: 6
Polar Surface Area: 66.40Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.85CX Basic pKa: CX LogP: 5.96CX LogD: 2.72
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -0.08

References

1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A.  (2021)  Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein.,  215  [PMID:33640763] [10.1016/j.ejmech.2021.113288]

Source