N-((2-(2,6-Dioxopiperidin-3-yl)-1-oxoisoindolin-5-yl)methyl)-2-oxo-2-phenylacetamide

ID: ALA4787201

PubChem CID: 155316388

Max Phase: Preclinical

Molecular Formula: C22H19N3O5

Molecular Weight: 405.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CCC(N2Cc3cc(CNC(=O)C(=O)c4ccccc4)ccc3C2=O)C(=O)N1

Standard InChI:  InChI=1S/C22H19N3O5/c26-18-9-8-17(20(28)24-18)25-12-15-10-13(6-7-16(15)22(25)30)11-23-21(29)19(27)14-4-2-1-3-5-14/h1-7,10,17H,8-9,11-12H2,(H,23,29)(H,24,26,28)

Standard InChI Key:  KOPIYCJOIBQNAV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.1399  -13.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1388  -14.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8468  -14.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8450  -13.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5536  -13.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5539  -14.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3369  -14.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8206  -14.1265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3364  -13.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6378  -14.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0454  -14.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8591  -14.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2712  -14.1328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8636  -13.4234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0438  -13.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0884  -14.1356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6357  -12.7121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5887  -12.6834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4307  -14.9464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7233  -14.5373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0153  -14.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3079  -14.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5999  -14.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8960  -14.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1884  -14.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1873  -15.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8997  -16.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6043  -15.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0147  -15.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3086  -13.7190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  8 10  1  0
 13 16  2  0
 15 17  2  0
  9 18  2  0
  2 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 21 29  2  0
 22 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4787201

    ---

Associated Targets(Human)

KG-1 (867 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
THLE-2 (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.41Molecular Weight (Monoisotopic): 405.1325AlogP: 0.95#Rotatable Bonds: 5
Polar Surface Area: 112.65Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.48CX Basic pKa: CX LogP: 0.78CX LogD: 0.78
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -0.30

References

1. Hansen JD,Correa M,Alexander M,Nagy M,Huang D,Sapienza J,Lu G,LeBrun LA,Cathers BE,Zhang W,Tang Y,Ammirante M,Narla RK,Piccotti JR,Pourdehnad M,Lopez-Girona A.  (2021)  CC-90009: A Cereblon E3 Ligase Modulating Drug That Promotes Selective Degradation of GSPT1 for the Treatment of Acute Myeloid Leukemia.,  64  (4.0): [PMID:33591756] [10.1021/acs.jmedchem.0c01489]

Source