The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4787286
PubChem CID: 162667846
Max Phase: Preclinical
Molecular Formula: C38H39F3N2O6
Molecular Weight: 676.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c3cc1Oc1c(OC)c(OC)cc4c1C(Cc1ccc(OC(F)(F)F)c(c1)Oc1ccc(cc1)CC3N(C)CC2)N(C)CC4
Standard InChI: InChI=1S/C38H39F3N2O6/c1-42-14-12-24-19-31(44-3)33-21-27(24)28(42)16-22-6-9-26(10-7-22)47-32-18-23(8-11-30(32)49-38(39,40)41)17-29-35-25(13-15-43(29)2)20-34(45-4)36(46-5)37(35)48-33/h6-11,18-21,28-29H,12-17H2,1-5H3
Standard InChI Key: GXYCRLYOVMMTJP-UHFFFAOYSA-N
Molfile:
RDKit 2D
49 55 0 0 0 0 0 0 0 0999 V2000
8.8901 -16.5626 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.3122 -17.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1051 -17.3539 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8015 -15.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6938 -12.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3940 -10.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8288 -10.2874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4213 -11.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3295 -15.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5476 -14.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5618 -12.8002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2720 -11.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1823 -12.7846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2463 -13.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6080 -15.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8325 -11.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8944 -15.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1329 -11.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9863 -10.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8370 -13.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4486 -13.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5410 -9.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1182 -11.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7612 -14.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5576 -15.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6063 -16.7348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3980 -11.1205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2744 -12.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9889 -11.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5523 -12.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5609 -11.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2704 -12.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1223 -12.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8487 -11.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8966 -14.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8208 -12.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0818 -13.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0836 -12.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5494 -14.0102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5520 -11.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3281 -14.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2681 -13.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2450 -14.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4213 -12.3876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6033 -14.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1134 -15.5740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8471 -12.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3115 -17.9621 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9213 -13.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
42 32 1 0
28 13 1 0
12 31 2 0
9 41 2 0
23 27 1 0
30 40 2 0
40 16 1 0
15 9 1 0
20 39 1 0
41 45 1 0
24 14 1 0
29 19 1 0
25 24 2 0
35 17 1 0
38 37 1 0
17 15 2 0
17 46 1 0
28 12 1 0
13 33 1 0
47 11 1 0
30 32 1 0
7 22 1 0
39 42 1 0
15 26 1 0
4 25 1 0
21 37 1 0
8 44 1 0
27 6 1 0
39 10 1 0
44 38 1 0
30 36 1 0
11 28 2 0
21 14 2 0
16 23 2 0
36 20 1 0
46 25 1 0
38 47 1 0
34 47 2 0
21 43 1 0
8 18 1 0
35 45 2 0
44 5 1 0
16 7 1 0
12 29 1 0
34 18 1 0
31 34 1 0
33 36 2 0
23 33 1 0
43 4 2 0
26 2 1 0
2 48 1 0
45 49 1 0
49 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 676.73Molecular Weight (Monoisotopic): 676.2760AlogP: 8.05#Rotatable Bonds: 4Polar Surface Area: 61.86Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.27CX LogP: 8.07CX LogD: 6.84Aromatic Rings: 4Heavy Atoms: 49QED Weighted: 0.22Np Likeness Score: 1.33
References 1. Schütz R,Müller M,Geisslinger F,Vollmar A,Bartel K,Bracher F. (2020) Synthesis, biological evaluation and toxicity of novel tetrandrine analogues., 207 [PMID:32942071 ] [10.1016/j.ejmech.2020.112810 ] 2. Schütz R,Müller M,Geisslinger F,Vollmar A,Bartel K,Bracher F. (2020) Synthesis, biological evaluation and toxicity of novel tetrandrine analogues., 207 [PMID:32942071 ] [10.1016/j.ejmech.2020.112810 ]