The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-((1S,2S)-1-cyano-2-phenylcyclopropylamino)-1-oxo-3-(thiophen-2-yl)propan-2-aminium 2,2,2-trifluoroacetate ID: ALA478737
PubChem CID: 49797572
Max Phase: Preclinical
Molecular Formula: C19H18F3N3O3S
Molecular Weight: 311.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#C[C@]1(NC(=O)[C@H](N)Cc2cccs2)C[C@H]1c1ccccc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C17H17N3OS.C2HF3O2/c18-11-17(10-14(17)12-5-2-1-3-6-12)20-16(21)15(19)9-13-7-4-8-22-13;3-2(4,5)1(6)7/h1-8,14-15H,9-10,19H2,(H,20,21);(H,6,7)/t14-,15+,17+;/m0./s1
Standard InChI Key: HSOZEOMYHDEMKF-FFMLRVAQSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
16.0139 -18.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0139 -19.0113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7280 -17.7766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2996 -17.7766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8370 -19.0113 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.0139 -19.8344 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.1908 -19.0113 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.1830 -18.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0037 -18.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2055 -17.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5017 -17.3929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.8738 -17.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9724 -17.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6210 -18.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3880 -17.7185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0408 -18.2282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5023 -16.9016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8036 -17.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2264 -18.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6304 -17.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6336 -17.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4631 -16.3006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2828 -19.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5642 -19.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5942 -20.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3216 -21.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0262 -20.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9961 -19.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5068 -18.8465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
2 5 1 0
2 6 1 0
2 7 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
18 16 1 1
19 18 1 0
20 19 1 0
18 20 1 0
18 21 1 0
21 22 3 0
19 23 1 1
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 8 2 0
10 13 1 0
14 29 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 311.41Molecular Weight (Monoisotopic): 311.1092AlogP: 2.18#Rotatable Bonds: 5Polar Surface Area: 78.91Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.63CX Basic pKa: 7.84CX LogP: 2.14CX LogD: 1.57Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.89Np Likeness Score: -0.62
References 1. Méthot N, Rubin J, Guay D, Beaulieu C, Ethier D, Reddy TJ, Riendeau D, Percival MD.. (2007) Inhibition of the activation of multiple serine proteases with a cathepsin C inhibitor requires sustained exposure to prevent pro-enzyme processing., 282 (29): [PMID:17535802 ] [10.1074/jbc.m702615200 ]