The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-4-(4-methylpiperazin-1-yl)but-2-enamide ID: ALA4787426
PubChem CID: 162667285
Max Phase: Preclinical
Molecular Formula: C29H36ClN7O4S
Molecular Weight: 614.17
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)/C=C/CN2CCN(C)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1
Standard InChI: InChI=1S/C29H36ClN7O4S/c1-20(2)42(39,40)26-9-6-5-8-24(26)33-28-22(30)19-31-29(35-28)34-23-12-11-21(18-25(23)41-4)32-27(38)10-7-13-37-16-14-36(3)15-17-37/h5-12,18-20H,13-17H2,1-4H3,(H,32,38)(H2,31,33,34,35)/b10-7+
Standard InChI Key: JFJBQYDTDVUFOI-JXMROGBWSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
17.6150 -28.5769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7978 -28.5769 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.2064 -29.2846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9137 -26.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9125 -27.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6206 -27.7624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3302 -27.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3274 -26.5303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6188 -26.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0386 -27.7605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7457 -27.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2045 -27.7615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4971 -27.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5023 -26.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7957 -26.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0867 -26.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0887 -27.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7958 -27.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4507 -27.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1573 -27.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1564 -26.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4431 -26.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7394 -26.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0925 -28.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4508 -28.5759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1585 -28.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3826 -28.5848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0971 -29.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2059 -26.1255 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.8629 -26.1209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5718 -26.5275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2783 -26.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5742 -27.3447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9872 -26.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6938 -26.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4026 -26.5193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4009 -27.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1057 -27.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8146 -27.3347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8142 -26.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1049 -26.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5220 -27.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
5 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 11 1 0
18 2 1 0
2 24 1 0
19 25 1 0
25 26 1 0
24 27 1 0
24 28 1 0
4 29 1 0
21 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 2 0
34 35 1 0
35 36 1 0
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 614.17Molecular Weight (Monoisotopic): 613.2238AlogP: 4.55#Rotatable Bonds: 11Polar Surface Area: 128.79Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.55CX Basic pKa: 7.98CX LogP: 4.22CX LogD: 3.54Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.26Np Likeness Score: -1.57
References 1. Zhu M,Li W,Zhao T,Chen Y,Li T,Wei S,Guo M,Zhai X. (2020) Fragment-based modification of 2,4-diarylaminopyrimidine derivatives as ALK and ROS1 dual inhibitors to overcome secondary mutants., 28 (20.0): [PMID:33069075 ] [10.1016/j.bmc.2020.115719 ]