Lycosquarrine J

ID: ALA4787922

PubChem CID: 162669086

Max Phase: Preclinical

Molecular Formula: C15H20N2O2

Molecular Weight: 260.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C1\[C@@H]2Cc3[nH]c(=O)ccc3[C@@]1(N)C[C@H](CO)C2

Standard InChI:  InChI=1S/C15H20N2O2/c1-2-11-10-5-9(8-18)7-15(11,16)12-3-4-14(19)17-13(12)6-10/h2-4,9-10,18H,5-8,16H2,1H3,(H,17,19)/b11-2+/t9-,10+,15-/m1/s1

Standard InChI Key:  JXOIHFVZSJWYBB-FFFLZLAFSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    4.0100  -20.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8997  -20.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8895  -19.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5463  -20.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5348  -20.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5673  -18.9900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5978  -20.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3226  -19.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4678  -19.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2716  -19.3893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7823  -19.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0882  -18.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2824  -20.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5285  -21.0046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2592  -21.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9826  -18.9669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3679  -18.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4454  -21.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7203  -20.2196    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8428  -17.4166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  1  1  0
  5  4  1  0
  6  3  1  0
  7  2  1  0
  8 12  1  0
  9  5  1  0
 10 13  1  0
 11  1  1  0
 12 11  1  0
 13  7  2  0
  1 14  1  1
 15  4  2  0
 16 10  2  0
 12 17  1  1
 18 15  1  0
  5 19  1  6
  8  5  1  0
  9  3  1  0
 10  6  1  0
 17 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4787922

    ---

Associated Targets(non-human)

ACHE Acetylcholinesterase (1035 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 260.34Molecular Weight (Monoisotopic): 260.1525AlogP: 1.05#Rotatable Bonds: 1
Polar Surface Area: 79.11Molecular Species: BASEHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.70CX Basic pKa: 8.85CX LogP: -0.34CX LogD: -1.79
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.66Np Likeness Score: 1.98

References

1. Zhu X,Xia D,Zhou Z,Xie S,Shi Z,Chen G,Wang L,Pan K.  (2020)  Lycosquarrines A-R, Lycopodium Alkaloids from Phlegmariurus squarrosus.,  83  (10): [PMID:32941036] [10.1021/acs.jnatprod.9b00815]

Source