2-(4-(4-aminobenzyl)phenylamino)-3-chloro-2,3-dihydronaphthalene-1,4-dione

ID: ALA4787936

PubChem CID: 162669236

Max Phase: Preclinical

Molecular Formula: C23H19ClN2O2

Molecular Weight: 390.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccc(Cc2ccc(NC3C(=O)c4ccccc4C(=O)C3Cl)cc2)cc1

Standard InChI:  InChI=1S/C23H19ClN2O2/c24-20-21(23(28)19-4-2-1-3-18(19)22(20)27)26-17-11-7-15(8-12-17)13-14-5-9-16(25)10-6-14/h1-12,20-21,26H,13,25H2

Standard InChI Key:  JOEYJQRSKDFRFA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    3.6167   -5.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6167   -6.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3288   -6.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3288   -5.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0409   -5.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0373   -6.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7461   -6.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4629   -6.3729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4665   -5.5479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7531   -5.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7555   -4.3051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7415   -7.6051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1751   -6.7894    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.1831   -5.1391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8954   -5.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8889   -6.3804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6004   -6.7966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3181   -6.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3198   -5.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6077   -5.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0309   -6.8031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7470   -6.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4577   -6.8117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1733   -6.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1769   -5.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4591   -5.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7464   -5.5729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8925   -5.1660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  7 12  2  0
  8 13  1  0
  9 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4787936

    ---

Associated Targets(Human)

CTH Tchem Cystathionine gamma-lyase (128 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.87Molecular Weight (Monoisotopic): 390.1135AlogP: 4.33#Rotatable Bonds: 4
Polar Surface Area: 72.19Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.78CX Basic pKa: 4.52CX LogP: 4.29CX LogD: 4.29
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: 0.16

References

1. Hu Y,Wang L,Han X,Zhou Y,Zhang T,Wang L,Hong T,Zhang W,Guo XX,Sun J,Qi Y,Yu J,Liu H,Wu F.  (2019)  Discovery of a Bioactive Inhibitor with a New Scaffold for Cystathionine γ-Lyase.,  62  (3): [PMID:30562026] [10.1021/acs.jmedchem.8b01720]

Source