((S)-7-Acetylamino-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydro-benzo[a]heptalen-4-ylmethyl)-carbamic acid ethyl ester

ID: ALA4788154

PubChem CID: 11329520

Max Phase: Preclinical

Molecular Formula: C26H32N2O8

Molecular Weight: 500.55

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CCOC(=O)NCc1c2c(c(OC)c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(C)=O)CC2

Standard InChI:  InChI=1S/C26H32N2O8/c1-7-36-26(31)27-13-18-16-8-10-19(28-14(2)29)17-12-20(30)21(32-3)11-9-15(17)22(16)24(34-5)25(35-6)23(18)33-4/h9,11-12,19H,7-8,10,13H2,1-6H3,(H,27,31)(H,28,29)/t19-/m0/s1

Standard InChI Key:  RWJNSQGYEWMGBZ-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   35.9440   -8.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7365   -8.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2961   -7.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5903   -8.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3844   -8.6177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8804   -7.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5850   -9.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3043   -6.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3968   -9.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0997   -7.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8804   -6.9585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9440   -9.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7488   -9.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9210   -7.3795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5986   -6.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9440   -6.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1315   -9.7980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.7406   -6.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5903   -9.0015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1788   -8.1925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1788   -6.5499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9346  -10.7556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8804   -9.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4689   -7.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3402  -11.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6034   -5.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3135   -5.3242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3184   -4.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0285   -4.1027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6131   -4.0943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3296   -8.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1468   -8.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9210   -8.7949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4696   -6.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7338   -4.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4439   -4.1111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  1  0
  5  2  2  0
  6  4  2  0
  7  1  2  0
  8  3  2  0
  9  5  1  0
 10  2  1  0
 11 15  2  0
 12  7  1  0
 13 12  2  0
 10 14  1  6
 15  8  1  0
 16  8  1  0
 17  9  2  0
 18 10  1  0
 19  4  1  0
 20  6  1  0
 21 11  1  0
 22 13  1  0
 23 19  1  0
 24 20  1  0
 25 22  1  0
  9 13  1  0
 16 18  1  0
 11  6  1  0
 15 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 14 31  1  0
 31 32  1  0
 31 33  2  0
 21 34  1  0
 29 35  1  0
 35 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4788154

   ethyl N-[[(7S)-7-acetamido-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-4-yl]methyl]carbamate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 500.55

Molecular Weight (Monoisotopic): 500.2159

AlogP: 3.12

#Rotatable Bonds: 8

Polar Surface Area: 121.42

Molecular Species: NEUTRAL

HBA: 8

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.78

CX Basic pKa: ┄

CX LogP: 1.38

CX LogD: 1.38

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.57

Np Likeness Score: 0.48

References

1. Gracheva IA,Shchegravina ES,Schmalz HG,Beletskaya IP,Fedorov AY.  (2020)  Colchicine Alkaloids and Synthetic Analogues: Current Progress and Perspectives.,  63  (19.0): [PMID:32432867] [10.1021/acs.jmedchem.0c00222]

Source

Source(1):

• Scientific Literature