The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{2'-[(1R,5S,7aS)-1-(3,5-Bis-trifluoromethyl-phenyl)-3-oxo-hexahydro-pyrrolo[1,2-c]imidazol-5-yl]-6-methoxy-4'-trifluoromethyl-biphenyl-3-yl}-propionic acid ID: ALA4788299
PubChem CID: 117850081
Max Phase: Preclinical
Molecular Formula: C31H25F9N2O4
Molecular Weight: 660.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCC(=O)O)cc1-c1ccc(C(F)(F)F)cc1[C@@H]1CC[C@H]2[C@@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)NC(=O)N12
Standard InChI: InChI=1S/C31H25F9N2O4/c1-46-25-8-2-15(3-9-26(43)44)10-22(25)20-5-4-17(29(32,33)34)14-21(20)23-6-7-24-27(41-28(45)42(23)24)16-11-18(30(35,36)37)13-19(12-16)31(38,39)40/h2,4-5,8,10-14,23-24,27H,3,6-7,9H2,1H3,(H,41,45)(H,43,44)/t23-,24-,27+/m0/s1
Standard InChI Key: ICKKJFHKJPPEKS-NLJOTIRTSA-N
Molfile:
RDKit 2D
47 51 0 0 0 0 0 0 0 0999 V2000
16.3397 -9.7980 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.7619 -9.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5463 -10.0137 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.4363 -6.9915 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2258 -7.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0215 -7.5742 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.3722 -3.7228 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.3763 -2.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6624 -3.3065 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.1979 -2.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6005 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4144 -3.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8267 -2.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4150 -2.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6024 -2.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9659 -2.1923 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8283 -4.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8121 -5.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6448 -4.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0988 -5.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4910 -5.0871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7867 -5.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9550 -6.2924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7675 -6.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1754 -7.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7645 -7.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1718 -8.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9940 -8.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4072 -7.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9933 -7.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6390 -8.5023 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.9410 -9.2195 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.6781 -6.2115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.6481 -2.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0539 -3.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8745 -3.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2892 -2.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8732 -2.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0540 -2.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6440 -1.4941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0512 -0.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0363 -5.1599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2831 -4.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1003 -4.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5078 -5.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3250 -5.0510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0981 -5.7568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
8 7 1 0
9 8 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
10 8 1 0
8 16 1 0
17 21 1 0
20 18 1 0
18 19 1 0
19 17 1 0
17 12 1 6
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
24 25 1 1
29 5 1 0
5 31 1 0
27 2 1 0
2 32 1 0
20 33 1 6
13 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
39 40 1 0
40 41 1 0
22 42 2 0
36 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
45 47 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 660.53Molecular Weight (Monoisotopic): 660.1671AlogP: 8.41#Rotatable Bonds: 7Polar Surface Area: 78.87Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.21CX Basic pKa: ┄CX LogP: 7.38CX LogD: 4.35Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.25Np Likeness Score: -0.06
References 1. Liu J,Shao PP,Guiadeen D,Krikorian A,Sun W,Deng Q,Cumiskey AM,Duffy RA,Murphy BA,Mitra K,Johns DG,Duffy JL,Vachal P. (2021) Cholesteryl ester transfer protein (CETP) inhibitors based on cyclic urea, bicyclic urea and bicyclic sulfamide cores., 32 [PMID:33161125 ] [10.1016/j.bmcl.2020.127668 ]