(10-(2,3-dihydroxybenzoyloxy)decyl)triphenylphosphonium bromide

ID: ALA4788330

PubChem CID: 162669390

Max Phase: Preclinical

Molecular Formula: C35H40BrO4P

Molecular Weight: 555.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(OCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cccc(O)c1O.[Br-]

Standard InChI:  InChI=1S/C35H39O4P.BrH/c36-33-26-18-25-32(34(33)37)35(38)39-27-16-5-3-1-2-4-6-17-28-40(29-19-10-7-11-20-29,30-21-12-8-13-22-30)31-23-14-9-15-24-31;/h7-15,18-26H,1-6,16-17,27-28H2,(H-,36,37,38);1H

Standard InChI Key:  IQGHTZJMVJCGGL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 43  0  0  0  0  0  0  0  0999 V2000
    4.4822  -18.8367    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.0132  -15.8880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0120  -16.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7201  -17.1165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4297  -16.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4269  -15.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7183  -15.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5531  -10.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5520  -11.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2600  -11.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9697  -11.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9668  -10.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2582  -10.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8439  -11.6570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2598  -12.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5520  -12.8836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9674  -12.8839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5518  -13.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8440  -14.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8438  -14.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1360  -15.3348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1358  -16.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4280  -16.5604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4278  -17.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7200  -17.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0124  -17.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3046  -17.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5970  -17.3769    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    3.8891  -17.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5972  -16.5597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3059  -16.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3064  -15.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5983  -14.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8881  -15.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8910  -16.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1836  -17.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4763  -17.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4756  -18.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1882  -19.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8926  -18.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8453  -10.0210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  9 14  1  0
 10 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 28  5  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 29 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 29  1  0
  8 41  1  0
M  CHG  2   1  -1  28   1
M  END

Associated Targets(Human)

CAL-27 (814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SCC-15 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.68Molecular Weight (Monoisotopic): 555.2659AlogP: 7.37#Rotatable Bonds: 15
Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.27CX Basic pKa: CX LogP: 9.72CX LogD: 9.71
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.07Np Likeness Score: 0.15

References

1. CatalAn, Mabel, Castro-Castillo, Vicente, Gajardo-de la Fuente, Javier, Aguilera, Jocelyn, Ferreira, Jorge, Ramires-Fernandez, Ricardo, Olmedo, Ivonne, Molina-Berrios, Alfredo, Palominos, Charlotte, Valencia, Marcelo, Dominguez, Marta, Souto, Jose A., Jara, Jose A..  (2020)  Continuous flow synthesis of lipophilic cations derived from benzoic acid as new cytotoxic chemical entities in human head and neck carcinoma cell lines,  11  (10): [PMID:33479625] [10.1039/d0md00153h]

Source