The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-((5-(2-cyanoethyl)-2-oxoindolin-3-ylidene)methyl)-N-(2-(diethylamino)ethyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide ID: ALA4788376
PubChem CID: 162669908
Max Phase: Preclinical
Molecular Formula: C25H31N5O2
Molecular Weight: 433.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(CCC#N)cc32)c1C
Standard InChI: InChI=1S/C25H31N5O2/c1-5-30(6-2)13-12-27-25(32)23-16(3)22(28-17(23)4)15-20-19-14-18(8-7-11-26)9-10-21(19)29-24(20)31/h9-10,14-15,28H,5-8,12-13H2,1-4H3,(H,27,32)(H,29,31)/b20-15-
Standard InChI Key: PIPKBPQXMOCACO-HKWRFOASSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
25.3149 -5.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3138 -5.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0286 -6.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0268 -4.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7422 -5.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7424 -5.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5329 -6.1548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0212 -5.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5325 -4.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7871 -4.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8462 -5.4819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5947 -3.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1463 -4.4665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8983 -4.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8114 -3.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0057 -3.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6695 -2.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4238 -2.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2088 -3.0135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2515 -1.9526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6131 -4.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8213 -2.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6062 -2.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2187 -2.1622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0035 -2.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6161 -1.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0463 -1.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6588 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5970 -4.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5966 -3.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3109 -3.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0235 -3.0095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 12 1 0
8 11 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
14 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
1 29 1 0
29 30 1 0
30 31 1 0
31 32 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.56Molecular Weight (Monoisotopic): 433.2478AlogP: 3.65#Rotatable Bonds: 9Polar Surface Area: 101.02Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.28CX Basic pKa: 9.04CX LogP: 2.92CX LogD: 1.28Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -0.86
References 1. Matheson CJ,Casalvieri KA,Backos DS,Minhajuddin M,Jordan CT,Reigan P. (2020) Substituted oxindol-3-ylidenes as AMP-activated protein kinase (AMPK) inhibitors., 197 [PMID:32334266 ] [10.1016/j.ejmech.2020.112316 ]