Rac-cis-9,10-epoxyoctadecanoic acid

ID: ALA4788671

Cas Number: 24560-98-3

PubChem CID: 119250

Max Phase: Preclinical

Molecular Formula: C18H34O3

Molecular Weight: 298.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCC[C@H]1O[C@H]1CCCCCCCC(=O)O

Standard InChI:  InChI=1S/C18H34O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/t16-,17+/m1/s1

Standard InChI Key:  IMYZYCNQZDBZBQ-SJORKVTESA-N

Molfile:  

 
     RDKit          2D

 21 21  0  0  0  0  0  0  0  0999 V2000
   16.1714  -23.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9965  -23.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5839  -22.9221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4571  -24.0512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7424  -23.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0282  -24.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3134  -23.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5991  -24.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8844  -23.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1701  -24.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4554  -23.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7107  -24.0512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4254  -23.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1397  -24.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8544  -23.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5687  -24.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2834  -23.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9977  -24.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7124  -23.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4266  -24.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7129  -22.8162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  1  4  1  1
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  2 12  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4788671

    Epoxyoleic acid

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 298.47Molecular Weight (Monoisotopic): 298.2508AlogP: 5.32#Rotatable Bonds: 15
Polar Surface Area: 49.83Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.62CX Basic pKa: CX LogP: 5.85CX LogD: 3.13
Aromatic Rings: Heavy Atoms: 21QED Weighted: 0.33Np Likeness Score: 0.90

References

1. Daskalova SM,Eisenhauer BM,Gao M,Feng X,Ji X,Cheng Q,Fahmi N,Khdour OM,Chen S,Hecht SM.  (2020)  An assay for DNA polymerase β lyase inhibitors that engage the catalytic nucleophile for binding.,  28  (17.0): [PMID:32773093] [10.1016/j.bmc.2020.115642]

Source