(R)-2-((S)-2-acetamido-3-(naphthalen-2-yl)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl)-4-phenylbutanamide

ID: ALA4788689

PubChem CID: 162669801

Max Phase: Preclinical

Molecular Formula: C34H36N4O5

Molecular Weight: 580.69

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NO

Standard InChI:  InChI=1S/C34H36N4O5/c1-23(39)35-30(22-26-16-18-27-14-8-9-15-28(27)20-26)33(41)36-29(19-17-24-10-4-2-5-11-24)32(40)37-31(34(42)38-43)21-25-12-6-3-7-13-25/h2-16,18,20,29-31,43H,17,19,21-22H2,1H3,(H,35,39)(H,36,41)(H,37,40)(H,38,42)/t29-,30+,31-/m1/s1

Standard InChI Key:  JAKLESMJTPJPHG-MJSOWUPRSA-N

Molfile:  

 
     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
   15.3657  -17.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0734  -16.9051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6580  -16.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3657  -18.1309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7811  -17.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4888  -16.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1965  -17.3137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4888  -16.0879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9042  -16.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6119  -17.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9042  -16.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6119  -15.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6119  -14.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3216  -14.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3219  -13.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6137  -13.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9036  -13.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9068  -14.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6119  -18.1309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3196  -16.9051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0273  -17.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7350  -16.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0273  -18.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7350  -18.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4428  -17.3137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1505  -16.9051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7350  -16.0879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7312  -19.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4381  -19.7663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1468  -19.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1442  -18.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4367  -18.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7811  -18.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4888  -18.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4843  -19.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8972  -18.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1898  -18.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8999  -19.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1931  -19.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1928  -20.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8984  -20.9854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6058  -20.5740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6027  -19.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 10 19  2  0
 10 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  1
 23 24  1  0
 22 25  1  0
 25 26  1  0
 22 27  2  0
 24 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 24  1  0
  5 33  1  6
 33 34  1  0
 34 35  2  0
 35 39  1  0
 38 36  1  0
 36 37  2  0
 37 34  1  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4788689

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 580.69Molecular Weight (Monoisotopic): 580.2686AlogP: 3.24#Rotatable Bonds: 13
Polar Surface Area: 136.63Molecular Species: NEUTRALHBA: 5HBD: 5
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 3.76CX LogD: 3.74
Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.12Np Likeness Score: 0.03

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source