The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3beta,23-O-isopropylidenyl-3beta,23-dihydroxyolean-12-en-28-oic acid ID: ALA4789029
PubChem CID: 162669810
Max Phase: Preclinical
Molecular Formula: C33H52O4
Molecular Weight: 512.78
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H]6OC(C)(C)OC[C@@]6(C)[C@@H]5CC[C@]43C)[C@@H]2C1
Standard InChI: InChI=1S/C33H52O4/c1-27(2)15-17-33(26(34)35)18-16-31(7)21(22(33)19-27)9-10-24-29(5)13-12-25-30(6,20-36-28(3,4)37-25)23(29)11-14-32(24,31)8/h9,22-25H,10-20H2,1-8H3,(H,34,35)/t22-,23+,24+,25-,29-,30-,31+,32+,33-/m0/s1
Standard InChI Key: GZTXRAOZNVKIDQ-ZOGWWOATSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
7.5487 -17.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9614 -18.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3698 -17.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8573 -23.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2700 -23.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4524 -23.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5251 -20.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8153 -20.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3914 -21.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5251 -19.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1013 -20.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3914 -21.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2309 -21.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8153 -21.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9449 -20.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8153 -19.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6774 -20.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1013 -22.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0930 -19.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9799 -21.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5210 -21.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8111 -20.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3790 -20.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3914 -22.6420 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2309 -20.1780 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.0930 -21.4162 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.6774 -22.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9799 -21.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2811 -22.2265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9713 -23.4428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6761 -23.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2700 -21.4203 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.6732 -21.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2350 -19.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9449 -19.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6605 -19.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6724 -18.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2407 -18.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6507 -20.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6497 -21.0035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3589 -19.7785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
8 7 1 0
9 11 1 0
35 15 1 0
34 10 1 0
10 7 1 0
11 8 1 0
12 18 1 0
27 12 1 0
13 7 1 0
14 8 1 0
15 13 1 0
16 10 2 0
17 9 1 0
18 14 1 0
19 16 1 0
20 17 1 0
7 21 1 6
8 22 1 1
9 23 1 1
12 24 1 6
34 25 1 1
11 26 1 6
19 11 1 0
12 9 1 0
28 20 1 0
27 28 1 0
27 31 1 0
28 29 1 0
29 5 1 0
5 30 1 0
30 31 1 0
28 32 1 6
27 33 1 1
34 35 1 0
34 38 1 0
35 36 1 0
36 37 1 0
37 2 1 0
2 38 1 0
35 39 1 1
39 40 2 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.78Molecular Weight (Monoisotopic): 512.3866AlogP: 8.00#Rotatable Bonds: 1Polar Surface Area: 55.76Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.74CX Basic pKa: ┄CX LogP: 7.02CX LogD: 4.41Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: 3.01
References 1. Zhang JF,Zhong WC,Li YC,Song YQ,Xia GY,Tian GH,Ge GB,Lin S. (2020) Bioactivity-Guided Discovery of Human Carboxylesterase Inhibitors from the Roots of Paeonia lactiflora., 83 (10): [PMID:32951423 ] [10.1021/acs.jnatprod.0c00464 ]