2-(4-hydroxy-2-oxo-1,6-diphenyl-1,2-dihydropyridin-3-ylthio)benzoic acid

ID: ALA4789081

PubChem CID: 54679812

Max Phase: Preclinical

Molecular Formula: C24H17NO4S

Molecular Weight: 415.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccccc1Sc1c(O)cc(-c2ccccc2)n(-c2ccccc2)c1=O

Standard InChI:  InChI=1S/C24H17NO4S/c26-20-15-19(16-9-3-1-4-10-16)25(17-11-5-2-6-12-17)23(27)22(20)30-21-14-8-7-13-18(21)24(28)29/h1-15,26H,(H,28,29)

Standard InChI Key:  SQTJYPQVUHOFMI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   10.6648   -6.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6648   -7.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3700   -7.4703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0753   -7.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0753   -6.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3700   -5.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3700   -5.0187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7842   -5.8421    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.7824   -7.4754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4907   -6.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4868   -7.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1924   -7.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9023   -7.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9021   -6.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1958   -5.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1959   -5.0272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9036   -4.6187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4882   -4.6186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3696   -8.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6603   -8.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6599   -9.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3682   -9.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0782   -9.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0751   -8.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9586   -7.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2500   -7.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5434   -7.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5441   -8.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2574   -8.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9611   -8.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  5  8  1  0
  4  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  1  0
 16 18  2  0
 15 16  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  3 19  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  2 25  1  0
M  END

Associated Targets(Human)

PTPN5 Tchem Tyrosine-protein phosphatase non-receptor type 5 (536 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.47Molecular Weight (Monoisotopic): 415.0878AlogP: 5.06#Rotatable Bonds: 5
Polar Surface Area: 79.53Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.29CX Basic pKa: CX LogP: 4.49CX LogD: 0.87
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -0.59

References

1. Hou X,Sun JP,Ge L,Liang X,Li K,Zhang Y,Fang H.  (2020)  Inhibition of striatal-enriched protein tyrosine phosphatase by targeting computationally revealed cryptic pockets.,  190  [PMID:32078861] [10.1016/j.ejmech.2020.112131]

Source