1-benzyl-5-nitro-3-(3-(piperidin-1-yl)propoxy)-1H-indazole hydrochloride

ID: ALA4789483

PubChem CID: 162669687

Max Phase: Preclinical

Molecular Formula: C22H27ClN4O3

Molecular Weight: 394.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=[N+]([O-])c1ccc2c(c1)c(OCCCN1CCCCC1)nn2Cc1ccccc1

Standard InChI:  InChI=1S/C22H26N4O3.ClH/c27-26(28)19-10-11-21-20(16-19)22(23-25(21)17-18-8-3-1-4-9-18)29-15-7-14-24-12-5-2-6-13-24;/h1,3-4,8-11,16H,2,5-7,12-15,17H2;1H

Standard InChI Key:  SVKFPDMGYUCODU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   29.7295   -2.0920    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.1463   -4.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1452   -4.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8599   -5.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8581   -3.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5734   -4.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5783   -4.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3700   -5.1541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8546   -4.4789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3622   -3.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6125   -3.0235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6296   -5.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0811   -6.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2767   -6.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7285   -6.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9879   -7.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8005   -7.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3451   -7.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4311   -3.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7168   -4.0752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4309   -2.8376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4184   -2.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6686   -2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4746   -1.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7248   -1.0990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5336   -0.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7846   -0.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2321    0.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4248    0.2935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1702   -0.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 10 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 19 20  2  0
 19 21  1  0
  2 19  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  CHG  2  19   1  21  -1
M  END

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.48Molecular Weight (Monoisotopic): 394.2005AlogP: 4.25#Rotatable Bonds: 8
Polar Surface Area: 73.43Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.16CX LogP: 4.45CX LogD: 2.69
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -1.72

References

1. Ibáñez-Escribano A,Reviriego F,Vela N,Fonseca-Berzal C,Nogal-Ruiz JJ,Arán VJ,Escario JA,Gómez-Barrio A.  (2021)  Promising hit compounds against resistant trichomoniasis: Synthesis and antiparasitic activity of 3-(ω-aminoalkoxy)-1-benzyl-5-nitroindazoles.,  37  [PMID:33556576] [10.1016/j.bmcl.2021.127843]

Source