Benzyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbonyl)-2-methyl piperazine-1-carboxylate

ID: ALA4789499

PubChem CID: 150949311

Max Phase: Preclinical

Molecular Formula: C28H28ClN7O3

Molecular Weight: 546.03

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)CCN1C(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C28H28ClN7O3/c1-17-15-35(11-12-36(17)28(38)39-16-18-5-3-2-4-6-18)27(37)26-30-22-10-9-20(29)13-21(22)25(32-26)31-24-14-23(33-34-24)19-7-8-19/h2-6,9-10,13-14,17,19H,7-8,11-12,15-16H2,1H3,(H2,30,31,32,33,34)/t17-/m1/s1

Standard InChI Key:  LJTGHARCXAMOKA-QGZVFWFLSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   24.3080   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3068   -5.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0149   -5.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0131   -3.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7217   -4.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7224   -5.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4310   -5.4075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1392   -4.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1345   -4.1745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4254   -3.7711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6002   -3.7765    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.4211   -2.9540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1266   -2.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8720   -2.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4156   -2.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0033   -1.5539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2049   -1.7282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2256   -2.3377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8893   -2.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9704   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8485   -5.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8517   -6.2197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5547   -4.9911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2612   -5.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9652   -4.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9662   -4.1754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2571   -3.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5469   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6730   -5.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6760   -3.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3838   -4.1724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6759   -2.9467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0914   -3.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7992   -4.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7964   -4.9868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5033   -5.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2120   -4.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2093   -4.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5018   -3.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 19 18  1  0
 20 19  1  0
 18 20  1  0
 15 18  1  0
  8 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  6
 30 31  1  0
 30 32  2  0
 26 30  1  0
 31 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4789499

    ---

Associated Targets(Human)

PAK4 Tchem Serine/threonine-protein kinase PAK 4 (3212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 546.03Molecular Weight (Monoisotopic): 545.1942AlogP: 5.11#Rotatable Bonds: 6
Polar Surface Area: 116.34Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 5.25CX LogD: 5.25
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: -1.38

References

1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D.  (2020)  Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor.,  186  [PMID:31757524] [10.1016/j.ejmech.2019.111878]

Source