1-(4-((4-amino-3-(1H-indol-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)methyl)piperidin-1-yl)ethanone

ID: ALA4789563

PubChem CID: 162668674

Max Phase: Preclinical

Molecular Formula: C21H23N7O

Molecular Weight: 389.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCC(Cn2nc(-c3c[nH]c4ccccc34)c3c(N)ncnc32)CC1

Standard InChI:  InChI=1S/C21H23N7O/c1-13(29)27-8-6-14(7-9-27)11-28-21-18(20(22)24-12-25-21)19(26-28)16-10-23-17-5-3-2-4-15(16)17/h2-5,10,12,14,23H,6-9,11H2,1H3,(H2,22,24,25)

Standard InChI Key:  HZNRBKQXNAXNTQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   28.8535  -27.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5511  -27.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7118  -24.9115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4773  -25.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0436  -26.2987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5083  -24.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5256  -26.5688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1786  -26.0660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9009  -25.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0762  -25.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8468  -26.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7387  -23.9322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2704  -24.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4798  -23.2441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8976  -23.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2078  -23.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0783  -24.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7135  -24.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4784  -24.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6044  -23.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9681  -23.3247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1330  -27.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4373  -27.8516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4561  -28.6708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1766  -29.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8783  -28.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7585  -29.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0411  -28.7052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7783  -29.9134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  5 11  2  0
 10  6  2  0
  6  3  1  0
 10 11  1  0
  8  9  2  0
  7  8  1  0
  9 10  1  0
 11  7  1  0
  6 12  1  0
  7  2  1  0
  9 13  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  2  1  1  0
  1 22  1  0
  1 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4789563

    ---

Associated Targets(Human)

PRKD2 Tchem Serine/threonine-protein kinase D2 (2847 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.46Molecular Weight (Monoisotopic): 389.1964AlogP: 2.82#Rotatable Bonds: 3
Polar Surface Area: 105.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.73CX LogP: 1.48CX LogD: 1.48
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -0.92

References

1. Gilles P,Kashyap RS,Freitas MJ,Ceusters S,Van Asch K,Janssens A,De Jonghe S,Persoons L,Cobbaut M,Daelemans D,Van Lint J,Voet ARD,De Borggraeve WM.  (2020)  Design, synthesis and biological evaluation of pyrazolo[3,4-d]pyrimidine-based protein kinase D inhibitors.,  205  [PMID:32835918] [10.1016/j.ejmech.2020.112638]

Source