The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Rac-(5S,aR) Methyl 5-(2-((3-((2-acetamido-3-methoxy-3-oxopropyl)thio)butanoyl)oxy)acetamido)-9,10,11-trimethoxy-6,7-dihydro-5H-dibenzo[a,c]cyclohepten-3-carboxylate ID: ALA4789567
PubChem CID: 162668795
Max Phase: Preclinical
Molecular Formula: C32H40N2O11S
Molecular Weight: 660.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc2c(c1)[C@@H](NC(=O)COC(=O)CC(C)SC[C@@H](NC(C)=O)C(=O)OC)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C32H40N2O11S/c1-17(46-16-24(32(39)44-7)33-18(2)35)12-27(37)45-15-26(36)34-23-11-9-19-14-25(40-3)29(41-4)30(42-5)28(19)21-10-8-20(13-22(21)23)31(38)43-6/h8,10,13-14,17,23-24H,9,11-12,15-16H2,1-7H3,(H,33,35)(H,34,36)/t17?,23-,24+/m0/s1
Standard InChI Key: HYBOQIFCJLLYNB-FDPJYKKHSA-N
Molfile:
RDKit 2D
46 48 0 0 0 0 0 0 0 0999 V2000
17.3147 -17.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3136 -18.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0260 -18.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0242 -16.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7406 -18.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7413 -17.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3913 -16.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2016 -16.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5568 -17.6154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3790 -17.6136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7928 -16.8965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6149 -16.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3759 -16.1854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0269 -19.2706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6012 -18.4475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6026 -16.8014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6024 -15.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8895 -18.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3152 -19.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2039 -18.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3949 -18.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1443 -19.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7057 -19.9453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5169 -19.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7597 -18.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0795 -20.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8320 -21.1554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8855 -20.1840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0261 -21.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0245 -16.1776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8508 -16.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2645 -15.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2677 -16.8911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0868 -15.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4981 -16.1703 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.4976 -14.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3203 -16.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7316 -16.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5538 -16.8816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3208 -17.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4986 -17.5944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7321 -18.3060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3213 -19.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9647 -16.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7869 -16.1692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5533 -15.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 21 1 0
7 8 1 0
8 9 1 0
20 9 1 0
9 10 1 6
10 11 1 0
11 12 1 0
11 13 2 0
3 14 1 0
2 15 1 0
1 16 1 0
16 17 1 0
15 18 1 0
14 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
12 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
34 36 1 0
35 37 1 0
37 38 1 0
38 39 1 1
38 40 1 0
40 41 2 0
40 42 1 0
42 43 1 0
39 44 1 0
44 45 2 0
44 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 660.74Molecular Weight (Monoisotopic): 660.2353AlogP: 3.00#Rotatable Bonds: 14Polar Surface Area: 164.79Molecular Species: NEUTRALHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.96CX Basic pKa: ┄CX LogP: 2.23CX LogD: 2.23Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.23Np Likeness Score: 0.16
References 1. Sazanova, Ekaterina S., Gracheva, Iuliia A., Allegro, Diane, Barbier, Pascale, Combes, Sebastien, Svirshchevskaya, Elena V., Fedorov, Alexey Yu. (2020) Allocolchicinoids bearing a Michael acceptor fragment for possible irreversible binding of tubulin, 11 (6): [PMID:33479669 ] [10.1039/d0md00060d ]