(2S)-N-[(R)-[4-(Cyclobutylmethoxy)phenyl](([(thiophen-2-yl)methyl]carbamoyl))methyl]-2-phenylpropanamide

ID: ALA4789643

PubChem CID: 162669578

Max Phase: Preclinical

Molecular Formula: C27H30N2O3S

Molecular Weight: 462.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](C(=O)N[C@@H](C(=O)NCc1cccs1)c1ccc(OCC2CCC2)cc1)c1ccccc1

Standard InChI:  InChI=1S/C27H30N2O3S/c1-19(21-9-3-2-4-10-21)26(30)29-25(27(31)28-17-24-11-6-16-33-24)22-12-14-23(15-13-22)32-18-20-7-5-8-20/h2-4,6,9-16,19-20,25H,5,7-8,17-18H2,1H3,(H,28,31)(H,29,30)/t19-,25+/m0/s1

Standard InChI Key:  VCSASDIQULIQAP-UQBPGWFLSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   13.1975  -29.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1963  -30.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9044  -30.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6140  -30.0687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6112  -29.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9026  -28.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3174  -28.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0266  -29.2407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7328  -28.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4420  -29.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1482  -28.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4451  -30.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7297  -28.0123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8534  -29.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5591  -28.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5565  -28.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8422  -27.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1395  -28.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3143  -28.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4883  -30.4772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7809  -30.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7815  -29.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0204  -27.6063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6050  -27.6117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6020  -26.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3081  -26.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0565  -26.7107    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.6010  -26.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1897  -25.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3911  -25.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3576  -28.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7802  -28.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2019  -28.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  6
  9 13  2  0
 11 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 11  1  0
  7 19  1  6
  2 20  1  0
 20 21  1  0
 21 22  1  0
 19 23  2  0
 19 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  2  0
 22 31  1  0
 31 32  1  0
 32 33  1  0
 33 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4789643

    ---

Associated Targets(Human)

GPR88 Tchem Probable G-protein coupled receptor 88 (760 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.62Molecular Weight (Monoisotopic): 462.1977AlogP: 5.20#Rotatable Bonds: 10
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.01CX Basic pKa: CX LogP: 5.11CX LogD: 5.11
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.38

References

1. Rahman MT,Decker AM,Langston TL,Mathews KM,Laudermilk L,Maitra R,Ma W,Darcq E,Kieffer BL,Jin C.  (2020)  Design, Synthesis, and Structure-Activity Relationship Studies of (4-Alkoxyphenyl)glycinamides and Bioisosteric 1,3,4-Oxadiazoles as GPR88 Agonists.,  63  (23): [PMID:33205975] [10.1021/acs.jmedchem.0c01581]

Source