The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(1-(benzo[d][1,3]dioxol-5-yl)cyclopropanecarboxamido)-4-phenylthiazole-5-carbonyl)benzoic acid ID: ALA4789667
PubChem CID: 162669704
Max Phase: Preclinical
Molecular Formula: C28H20N2O6S
Molecular Weight: 512.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(C(=O)c2sc(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)nc2-c2ccccc2)cc1
Standard InChI: InChI=1S/C28H20N2O6S/c31-23(17-6-8-18(9-7-17)25(32)33)24-22(16-4-2-1-3-5-16)29-27(37-24)30-26(34)28(12-13-28)19-10-11-20-21(14-19)36-15-35-20/h1-11,14H,12-13,15H2,(H,32,33)(H,29,30,34)
Standard InChI Key: VCOOIMDXBONRHL-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
16.0488 -20.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8660 -20.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4574 -19.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0393 -19.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7490 -19.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7462 -18.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0376 -17.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3313 -19.0660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3325 -18.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5563 -17.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0753 -18.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5544 -19.3171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1644 -19.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8728 -19.4708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1631 -18.2461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5798 -19.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3225 -19.3935 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.8684 -18.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4586 -18.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6596 -18.2495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7890 -17.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6028 -17.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9340 -16.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4524 -15.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6359 -15.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3085 -16.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6812 -18.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1605 -18.2076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0148 -19.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5352 -20.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8681 -21.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6818 -21.1050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1614 -20.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8259 -19.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0163 -21.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5379 -22.5131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8293 -21.9337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
5 3 1 0
3 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
19 21 1 0
18 27 1 0
27 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
35 36 2 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.54Molecular Weight (Monoisotopic): 512.1042AlogP: 5.14#Rotatable Bonds: 7Polar Surface Area: 114.82Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.72CX Basic pKa: ┄CX LogP: 5.93CX LogD: 2.48Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -0.92
References 1. Parodi A,Righetti G,Pesce E,Salis A,Tasso B,Urbinati C,Tomati V,Damonte G,Rusnati M,Pedemonte N,Cichero E,Millo E. (2020) Discovery of novel VX-809 hybrid derivatives as F508del-CFTR correctors by molecular modeling, chemical synthesis and biological assays., 208 [PMID:32971410 ] [10.1016/j.ejmech.2020.112833 ]