4-(2-(1-(benzo[d][1,3]dioxol-5-yl)cyclopropanecarboxamido)-4-phenylthiazole-5-carbonyl)benzoic acid

ID: ALA4789667

PubChem CID: 162669704

Max Phase: Preclinical

Molecular Formula: C28H20N2O6S

Molecular Weight: 512.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(C(=O)c2sc(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)nc2-c2ccccc2)cc1

Standard InChI:  InChI=1S/C28H20N2O6S/c31-23(17-6-8-18(9-7-17)25(32)33)24-22(16-4-2-1-3-5-16)29-27(37-24)30-26(34)28(12-13-28)19-10-11-20-21(14-19)36-15-35-20/h1-11,14H,12-13,15H2,(H,32,33)(H,29,30,34)

Standard InChI Key:  VCOOIMDXBONRHL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   16.0488  -20.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8660  -20.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4574  -19.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0393  -19.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7490  -19.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7462  -18.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0376  -17.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3313  -19.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3325  -18.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5563  -17.9959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0753  -18.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5544  -19.3171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1644  -19.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8728  -19.4708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1631  -18.2461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5798  -19.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3225  -19.3935    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.8684  -18.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4586  -18.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6596  -18.2495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7890  -17.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6028  -17.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9340  -16.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4524  -15.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6359  -15.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3085  -16.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6812  -18.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1605  -18.2076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0148  -19.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5352  -20.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8681  -21.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6818  -21.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1614  -20.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8259  -19.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0163  -21.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5379  -22.5131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8293  -21.9337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  5  3  1  0
  3 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  2  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 18 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 35 36  2  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4789667

    ---

Associated Targets(Human)

CFTR Tclin Cystic fibrosis transmembrane conductance regulator (2075 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.54Molecular Weight (Monoisotopic): 512.1042AlogP: 5.14#Rotatable Bonds: 7
Polar Surface Area: 114.82Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.72CX Basic pKa: CX LogP: 5.93CX LogD: 2.48
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -0.92

References

1. Parodi A,Righetti G,Pesce E,Salis A,Tasso B,Urbinati C,Tomati V,Damonte G,Rusnati M,Pedemonte N,Cichero E,Millo E.  (2020)  Discovery of novel VX-809 hybrid derivatives as F508del-CFTR correctors by molecular modeling, chemical synthesis and biological assays.,  208  [PMID:32971410] [10.1016/j.ejmech.2020.112833]

Source