The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-Nalpha-Diphenylacetyl-Nomega-(3-bromopropanoylaminoethyl)aminocarbonyl(4-hydroxybenzyl)argininamide hydrotrifluoroacetate ID: ALA4789673
PubChem CID: 162669844
Max Phase: Preclinical
Molecular Formula: C35H41BrF3N7O7
Molecular Weight: 694.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N/C(=N/C(=O)NCCNC(=O)CCBr)NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C33H40BrN7O5.C2HF3O2/c34-18-17-28(43)36-20-21-38-33(46)41-32(35)37-19-7-12-27(30(44)39-22-23-13-15-26(42)16-14-23)40-31(45)29(24-8-3-1-4-9-24)25-10-5-2-6-11-25;3-2(4,5)1(6)7/h1-6,8-11,13-16,27,29,42H,7,12,17-22H2,(H,36,43)(H,39,44)(H,40,45)(H4,35,37,38,41,46);(H,6,7)/t27-;/m1./s1
Standard InChI Key: TXFPZKULVKWTEP-HZPIKELBSA-N
Molfile:
RDKit 2D
53 54 0 0 0 0 0 0 0 0999 V2000
42.8324 -13.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5401 -13.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2478 -13.4465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5401 -12.2207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1247 -13.0379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.8324 -14.2637 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.1225 -13.8510 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.9989 -14.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7066 -13.7726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2912 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5835 -14.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2912 -12.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4143 -14.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1220 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8297 -14.1812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5374 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2451 -14.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0023 -12.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0026 -11.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2944 -11.3247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5843 -11.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5875 -12.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8763 -13.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1691 -14.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1687 -14.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8814 -15.4039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5857 -14.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2431 -14.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9499 -15.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6586 -14.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6560 -14.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9485 -13.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9989 -14.9983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1220 -12.9554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3669 -15.4069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4143 -14.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1220 -15.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1220 -16.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8297 -16.6327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8297 -17.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1220 -17.8585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5374 -17.8585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2451 -17.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9529 -17.8585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.6606 -17.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3683 -17.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0760 -17.4499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.7837 -17.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4914 -17.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7837 -18.6757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2451 -16.6327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.1991 -17.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9068 -17.4499 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
8 9 1 0
8 10 1 0
10 11 1 0
10 12 1 0
9 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
11 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 11 1 0
17 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 17 1 0
8 33 2 0
14 34 2 0
30 35 1 0
13 36 1 1
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
40 42 2 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
47 48 1 0
48 49 1 0
48 50 2 0
43 51 2 0
49 52 1 0
52 53 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 694.63Molecular Weight (Monoisotopic): 693.2274AlogP: 2.62#Rotatable Bonds: 16Polar Surface Area: 187.04Molecular Species: BASEHBA: 5HBD: 7#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.49CX Basic pKa: 8.96CX LogP: 1.79CX LogD: 0.68Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.05Np Likeness Score: -0.36
References 1. Buschmann, Jonas, Seiler, Theresa, Bernhardt, Gunther, Keller, Max, Wifling, David. (2020) Argininamide-type neuropeptide Y Y1 receptor antagonists: the nature of Nomega-carbamoyl substituents determines Y1R binding mode and affinity, 11 (2): [PMID:33479634 ] [10.1039/c9md00538b ]