N-Ethyl-6-(3-nitrophenyl)-1H-benzo[d]imidazol-2-amine

ID: ALA4789763

PubChem CID: 162669199

Max Phase: Preclinical

Molecular Formula: C15H14N4O2

Molecular Weight: 282.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCNc1nc2ccc(-c3cccc([N+](=O)[O-])c3)cc2[nH]1

Standard InChI:  InChI=1S/C15H14N4O2/c1-2-16-15-17-13-7-6-11(9-14(13)18-15)10-4-3-5-12(8-10)19(20)21/h3-9H,2H2,1H3,(H2,16,17,18)

Standard InChI Key:  IMLHHEWFUBFJGX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   28.1953   -7.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1942   -8.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9086   -8.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9069   -6.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6218   -7.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6220   -8.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4121   -8.4292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9001   -7.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4117   -7.0854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7239   -7.7597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1383   -7.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9676   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4833   -6.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4845   -6.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7711   -5.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0562   -6.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0590   -6.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7730   -7.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7705   -4.8667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0566   -4.4543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4847   -4.4546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  1 13  1  0
 19 20  2  0
 19 21  1  0
 15 19  1  0
M  CHG  2  19   1  21  -1
M  END

Alternative Forms

  1. Parent:

    ALA4789763

    ---

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 282.30Molecular Weight (Monoisotopic): 282.1117AlogP: 3.57#Rotatable Bonds: 4
Polar Surface Area: 83.85Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.28CX Basic pKa: 6.92CX LogP: 3.36CX LogD: 3.24
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.57Np Likeness Score: -1.38

References

1. Benchekroun M,Ermolenko L,Tran MQ,Vagneux A,Nedev H,Delehouzé C,Souab M,Baratte B,Josselin B,Iorga BI,Ruchaud S,Bach S,Al-Mourabit A.  (2020)  Discovery of simplified benzazole fragments derived from the marine benzosceptrin B as necroptosis inhibitors involving the receptor interacting protein Kinase-1.,  201  [PMID:32659605] [10.1016/j.ejmech.2020.112337]

Source