The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-Nitrobenzamido)benzyl)-3-benzyloxybenzothiophene-2-carboxamide ID: ALA4789800
PubChem CID: 162669716
Max Phase: Preclinical
Molecular Formula: C30H23N3O5S
Molecular Weight: 537.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2ccccc2)c1)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C30H23N3O5S/c34-29(22-13-15-24(16-14-22)33(36)37)32-23-10-6-9-21(17-23)18-31-30(35)28-27(25-11-4-5-12-26(25)39-28)38-19-20-7-2-1-3-8-20/h1-17H,18-19H2,(H,31,35)(H,32,34)
Standard InChI Key: UVZAZJXQOGNVTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
27.9807 -25.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4679 -26.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7655 -27.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5754 -27.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7867 -25.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0888 -26.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9072 -26.4854 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.1108 -25.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4183 -25.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8705 -25.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5111 -25.8973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9895 -24.5815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2708 -25.5961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9115 -26.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7911 -26.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4310 -27.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1916 -27.1151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3087 -26.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6677 -25.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0673 -25.9982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7097 -26.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4683 -26.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1095 -26.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8676 -26.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9843 -25.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3369 -25.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5815 -25.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5935 -27.3121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3667 -24.4365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6346 -24.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5829 -23.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2661 -22.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2148 -21.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4821 -21.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7996 -22.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8542 -22.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7460 -25.2894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3891 -25.7936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8611 -24.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 1 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
9 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
37 38 1 0
37 39 2 0
25 37 1 0
M CHG 2 37 1 38 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.60Molecular Weight (Monoisotopic): 537.1358AlogP: 6.57#Rotatable Bonds: 9Polar Surface Area: 110.57Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.77CX Basic pKa: ┄CX LogP: 6.38CX LogD: 6.38Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.16Np Likeness Score: -1.53
References 1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H. (2020) Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family., 204 [PMID:32717481 ] [10.1016/j.ejmech.2020.112553 ]