N-(3-(4-Nitrobenzamido)benzyl)-3-benzyloxybenzothiophene-2-carboxamide

ID: ALA4789800

PubChem CID: 162669716

Max Phase: Preclinical

Molecular Formula: C30H23N3O5S

Molecular Weight: 537.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2ccccc2)c1)c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C30H23N3O5S/c34-29(22-13-15-24(16-14-22)33(36)37)32-23-10-6-9-21(17-23)18-31-30(35)28-27(25-11-4-5-12-26(25)39-28)38-19-20-7-2-1-3-8-20/h1-17H,18-19H2,(H,31,35)(H,32,34)

Standard InChI Key:  UVZAZJXQOGNVTD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   27.9807  -25.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4679  -26.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7655  -27.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5754  -27.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7867  -25.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0888  -26.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9072  -26.4854    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.1108  -25.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4183  -25.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8705  -25.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5111  -25.8973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9895  -24.5815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2708  -25.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9115  -26.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7911  -26.9090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4310  -27.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1916  -27.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3087  -26.3020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6677  -25.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0673  -25.9982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7097  -26.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4683  -26.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1095  -26.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8676  -26.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9843  -25.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3369  -25.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5815  -25.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5935  -27.3121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3667  -24.4365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6346  -24.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5829  -23.2579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2661  -22.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2148  -21.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4821  -21.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7996  -22.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8542  -22.9008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7460  -25.2894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.3891  -25.7936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8611  -24.4803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 21 28  2  0
  9 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 37 38  1  0
 37 39  2  0
 25 37  1  0
M  CHG  2  37   1  38  -1
M  END

Alternative Forms

  1. Parent:

    ALA4789800

    ---

Associated Targets(Human)

SENP1 Tchem Sentrin-specific protease 1 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP2 Tchem Sentrin-specific protease 2 (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP5 Tbio Sentrin-specific protease 5 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.60Molecular Weight (Monoisotopic): 537.1358AlogP: 6.57#Rotatable Bonds: 9
Polar Surface Area: 110.57Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.77CX Basic pKa: CX LogP: 6.38CX LogD: 6.38
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.16Np Likeness Score: -1.53

References

1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H.  (2020)  Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family.,  204  [PMID:32717481] [10.1016/j.ejmech.2020.112553]

Source