The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4-difluoro-N3-(3-((4-fluorophenyl)carbamoyl)-1H-pyrazol-4-yl)-N3'-(2-(4-methylpiperazin-1-yl)ethyl)-[1,1'-biphenyl]-3,3'-dicarboxamide ID: ALA4789896
PubChem CID: 162668679
Max Phase: Preclinical
Molecular Formula: C31H30F3N7O3
Molecular Weight: 605.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(CCNC(=O)c2cccc(-c3ccc(F)c(C(=O)Nc4c[nH]nc4C(=O)Nc4ccc(F)cc4)c3F)c2)CC1
Standard InChI: InChI=1S/C31H30F3N7O3/c1-40-13-15-41(16-14-40)12-11-35-29(42)20-4-2-3-19(17-20)23-9-10-24(33)26(27(23)34)30(43)38-25-18-36-39-28(25)31(44)37-22-7-5-21(32)6-8-22/h2-10,17-18H,11-16H2,1H3,(H,35,42)(H,36,39)(H,37,44)(H,38,43)
Standard InChI Key: OSFZNJFOHBZGNK-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
26.9298 -4.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6126 -7.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7590 -7.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0417 -8.7743 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.6112 -6.5391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0419 -7.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2111 -6.2461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8974 -7.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6134 -8.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8266 -6.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4762 -8.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7642 -4.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1895 -7.5324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2111 -8.2179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8858 -3.0167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.3262 -7.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9012 -9.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1823 -7.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1642 -5.1846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6574 -7.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4749 -7.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3802 -5.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1812 -8.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7177 -3.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9911 -8.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9054 -7.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7562 -6.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3335 -4.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4698 -6.2876 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.7991 -8.9339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0400 -6.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3274 -6.7069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4744 -7.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4754 -6.7162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7654 -7.9424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0575 -7.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3485 -7.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6405 -7.5306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6462 -6.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9423 -6.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2309 -6.7093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2279 -7.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9362 -7.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5245 -6.2967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25 30 1 0
22 19 2 0
19 28 1 0
3 27 1 0
17 9 2 0
26 25 2 0
16 6 1 0
10 7 1 0
8 18 1 0
9 2 1 0
14 20 2 0
23 17 1 0
18 23 2 0
7 22 1 0
12 22 1 0
3 21 1 0
13 26 1 0
20 10 1 0
2 8 2 0
16 2 1 0
31 32 1 0
21 11 2 0
28 24 2 0
1 12 2 0
6 3 2 0
27 31 2 0
27 29 1 0
10 5 2 0
21 13 1 0
30 14 1 0
24 15 1 0
6 4 1 0
32 16 2 0
24 1 1 0
20 26 1 0
18 33 1 0
33 34 2 0
33 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
38 43 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
41 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.62Molecular Weight (Monoisotopic): 605.2362AlogP: 3.98#Rotatable Bonds: 9Polar Surface Area: 122.46Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.30CX Basic pKa: 7.80CX LogP: 3.66CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.23Np Likeness Score: -1.72
References 1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B. (2021) Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors., 215 [PMID:33611192 ] [10.1016/j.ejmech.2021.113281 ]