2,4-difluoro-N3-(3-((4-fluorophenyl)carbamoyl)-1H-pyrazol-4-yl)-N3'-(2-(4-methylpiperazin-1-yl)ethyl)-[1,1'-biphenyl]-3,3'-dicarboxamide

ID: ALA4789896

PubChem CID: 162668679

Max Phase: Preclinical

Molecular Formula: C31H30F3N7O3

Molecular Weight: 605.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(CCNC(=O)c2cccc(-c3ccc(F)c(C(=O)Nc4c[nH]nc4C(=O)Nc4ccc(F)cc4)c3F)c2)CC1

Standard InChI:  InChI=1S/C31H30F3N7O3/c1-40-13-15-41(16-14-40)12-11-35-29(42)20-4-2-3-19(17-20)23-9-10-24(33)26(27(23)34)30(43)38-25-18-36-39-28(25)31(44)37-22-7-5-21(32)6-8-22/h2-10,17-18H,11-16H2,1H3,(H,35,42)(H,36,39)(H,37,44)(H,38,43)

Standard InChI Key:  OSFZNJFOHBZGNK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 44 48  0  0  0  0  0  0  0  0999 V2000
   26.9298   -4.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6126   -7.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7590   -7.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0417   -8.7743    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.6112   -6.5391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0419   -7.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2111   -6.2461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8974   -7.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6134   -8.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8266   -6.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4762   -8.7723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7642   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1895   -7.5324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2111   -8.2179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8858   -3.0167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.3262   -7.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9012   -9.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1823   -7.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1642   -5.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6574   -7.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4749   -7.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3802   -5.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1812   -8.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7177   -3.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9911   -8.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9054   -7.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7562   -6.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3335   -4.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4698   -6.2876    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.7991   -8.9339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0400   -6.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3274   -6.7069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4744   -7.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4754   -6.7162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7654   -7.9424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0575   -7.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3485   -7.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6405   -7.5306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6462   -6.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9423   -6.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2309   -6.7093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2279   -7.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9362   -7.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5245   -6.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 25 30  1  0
 22 19  2  0
 19 28  1  0
  3 27  1  0
 17  9  2  0
 26 25  2  0
 16  6  1  0
 10  7  1  0
  8 18  1  0
  9  2  1  0
 14 20  2  0
 23 17  1  0
 18 23  2  0
  7 22  1  0
 12 22  1  0
  3 21  1  0
 13 26  1  0
 20 10  1  0
  2  8  2  0
 16  2  1  0
 31 32  1  0
 21 11  2  0
 28 24  2  0
  1 12  2  0
  6  3  2  0
 27 31  2  0
 27 29  1  0
 10  5  2  0
 21 13  1  0
 30 14  1  0
 24 15  1  0
  6  4  1  0
 32 16  2  0
 24  1  1  0
 20 26  1  0
 18 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 38 43  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 41 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4789896

    ---

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1/cyclin B1 (1887 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2058 (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 605.62Molecular Weight (Monoisotopic): 605.2362AlogP: 3.98#Rotatable Bonds: 9
Polar Surface Area: 122.46Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.30CX Basic pKa: 7.80CX LogP: 3.66CX LogD: 3.30
Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.23Np Likeness Score: -1.72

References

1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B.  (2021)  Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors.,  215  [PMID:33611192] [10.1016/j.ejmech.2021.113281]

Source