The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(tert-butyl)-1-methyl-1H-pyrazol-5-yl)-2-(4-((6-(1-methyl-1H-pyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino)phenyl)acetamide ID: ALA4789906
PubChem CID: 162668688
Max Phase: Preclinical
Molecular Formula: C26H29N9O
Molecular Weight: 483.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(-c2cc3c(Nc4ccc(CC(=O)Nc5cc(C(C)(C)C)nn5C)cc4)ncnc3[nH]2)cn1
Standard InChI: InChI=1S/C26H29N9O/c1-26(2,3)21-12-22(35(5)33-21)32-23(36)10-16-6-8-18(9-7-16)30-24-19-11-20(17-13-29-34(4)14-17)31-25(19)28-15-27-24/h6-9,11-15H,10H2,1-5H3,(H,32,36)(H2,27,28,30,31)
Standard InChI Key: JYNPEWRXWQEJMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
27.0003 -1.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0045 -2.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7101 -1.8124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2438 -4.5193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2427 -5.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9507 -5.7478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9490 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6576 -4.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6624 -5.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4424 -5.5827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9198 -4.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4347 -4.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9465 -3.2932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6530 -2.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3598 -3.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0658 -2.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0638 -2.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3499 -1.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6468 -2.0693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7698 -1.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4792 -2.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1852 -1.6455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4828 -2.8744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8946 -2.0511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9875 -2.8593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7876 -3.0257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1931 -2.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6436 -1.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4887 -2.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3840 -3.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7369 -4.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2187 -5.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9944 -5.3157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9896 -4.4984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2109 -4.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6583 -5.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
7 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 2 0
27 2 1 0
2 29 1 0
25 30 1 0
11 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 2 0
35 31 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.58Molecular Weight (Monoisotopic): 483.2495AlogP: 4.31#Rotatable Bonds: 6Polar Surface Area: 118.34Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.75CX Basic pKa: 5.52CX LogP: 4.07CX LogD: 4.06Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.84
References 1. Lakkaniga NR,Gunaganti N,Zhang L,Belachew B,Frett B,Leung YK,Li HY. (2020) Pyrrolo[2,3-d]pyrimidine derivatives as inhibitors of RET: Design, synthesis and biological evaluation., 206 [PMID:32823007 ] [10.1016/j.ejmech.2020.112691 ]