N-(3-(tert-butyl)-1-methyl-1H-pyrazol-5-yl)-2-(4-((6-(1-methyl-1H-pyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino)phenyl)acetamide

ID: ALA4789906

PubChem CID: 162668688

Max Phase: Preclinical

Molecular Formula: C26H29N9O

Molecular Weight: 483.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1cc(-c2cc3c(Nc4ccc(CC(=O)Nc5cc(C(C)(C)C)nn5C)cc4)ncnc3[nH]2)cn1

Standard InChI:  InChI=1S/C26H29N9O/c1-26(2,3)21-12-22(35(5)33-21)32-23(36)10-16-6-8-18(9-7-16)30-24-19-11-20(17-13-29-34(4)14-17)31-25(19)28-15-27-24/h6-9,11-15H,10H2,1-5H3,(H,32,36)(H2,27,28,30,31)

Standard InChI Key:  JYNPEWRXWQEJMQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   27.0003   -1.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0045   -2.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7101   -1.8124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2438   -4.5193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2427   -5.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9507   -5.7478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9490   -4.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6576   -4.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6624   -5.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4424   -5.5827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9198   -4.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4347   -4.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9465   -3.2932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6530   -2.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3598   -3.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0658   -2.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0638   -2.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3499   -1.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6468   -2.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7698   -1.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4792   -2.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1852   -1.6455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4828   -2.8744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8946   -2.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9875   -2.8593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7876   -3.0257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1931   -2.3162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6436   -1.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4887   -2.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3840   -3.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7369   -4.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2187   -5.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9944   -5.3157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9896   -4.4984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2109   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6583   -5.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
  7 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  2  0
 27  2  1  0
  2 29  1  0
 25 30  1  0
 11 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 31  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4789906

    ---

Associated Targets(Human)

RET Tclin Tyrosine-protein kinase receptor RET (6732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.58Molecular Weight (Monoisotopic): 483.2495AlogP: 4.31#Rotatable Bonds: 6
Polar Surface Area: 118.34Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.75CX Basic pKa: 5.52CX LogP: 4.07CX LogD: 4.06
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.84

References

1. Lakkaniga NR,Gunaganti N,Zhang L,Belachew B,Frett B,Leung YK,Li HY.  (2020)  Pyrrolo[2,3-d]pyrimidine derivatives as inhibitors of RET: Design, synthesis and biological evaluation.,  206  [PMID:32823007] [10.1016/j.ejmech.2020.112691]

Source