The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-N-[(R)-(4-[(2-Methylpentyl)oxy]phenyl)(phenylcarbamoyl)methyl]-2-phenylpropanamide ID: ALA4790074
PubChem CID: 162670172
Max Phase: Preclinical
Molecular Formula: C29H34N2O3
Molecular Weight: 458.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(C)COc1ccc([C@@H](NC(=O)[C@@H](C)c2ccccc2)C(=O)Nc2ccccc2)cc1
Standard InChI: InChI=1S/C29H34N2O3/c1-4-11-21(2)20-34-26-18-16-24(17-19-26)27(29(33)30-25-14-9-6-10-15-25)31-28(32)22(3)23-12-7-5-8-13-23/h5-10,12-19,21-22,27H,4,11,20H2,1-3H3,(H,30,33)(H,31,32)/t21?,22-,27+/m0/s1
Standard InChI Key: PROYOBJYJLSJDN-GYZHRQORSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
4.4147 -16.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4136 -16.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1216 -17.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8313 -16.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8284 -16.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1198 -15.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5346 -15.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2439 -16.0047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9500 -15.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6593 -15.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3654 -15.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6623 -16.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9469 -14.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0707 -15.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7764 -15.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7737 -14.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0595 -14.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3567 -14.7743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5315 -14.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7055 -17.2412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9982 -16.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9988 -16.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7068 -15.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2914 -15.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2921 -14.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5847 -14.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2377 -14.3703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8223 -14.3756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8192 -13.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5272 -13.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5244 -12.3327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8147 -11.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1062 -12.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1124 -13.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 1 6
9 13 2 0
11 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 11 1 0
7 19 1 6
2 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
24 25 1 0
25 26 1 0
19 27 2 0
19 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2569AlogP: 6.10#Rotatable Bonds: 11Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.09CX Basic pKa: ┄CX LogP: 6.40CX LogD: 6.40Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -0.68
References 1. Rahman MT,Decker AM,Langston TL,Mathews KM,Laudermilk L,Maitra R,Ma W,Darcq E,Kieffer BL,Jin C. (2020) Design, Synthesis, and Structure-Activity Relationship Studies of (4-Alkoxyphenyl)glycinamides and Bioisosteric 1,3,4-Oxadiazoles as GPR88 Agonists., 63 (23): [PMID:33205975 ] [10.1021/acs.jmedchem.0c01581 ]