(2S)-N-[(R)-(4-[(2-Methylpentyl)oxy]phenyl)(phenylcarbamoyl)methyl]-2-phenylpropanamide

ID: ALA4790074

PubChem CID: 162670172

Max Phase: Preclinical

Molecular Formula: C29H34N2O3

Molecular Weight: 458.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C)COc1ccc([C@@H](NC(=O)[C@@H](C)c2ccccc2)C(=O)Nc2ccccc2)cc1

Standard InChI:  InChI=1S/C29H34N2O3/c1-4-11-21(2)20-34-26-18-16-24(17-19-26)27(29(33)30-25-14-9-6-10-15-25)31-28(32)22(3)23-12-7-5-8-13-23/h5-10,12-19,21-22,27H,4,11,20H2,1-3H3,(H,30,33)(H,31,32)/t21?,22-,27+/m0/s1

Standard InChI Key:  PROYOBJYJLSJDN-GYZHRQORSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    4.4147  -16.0136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4136  -16.8331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1216  -17.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8313  -16.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8284  -16.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1198  -15.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5346  -15.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2439  -16.0047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9500  -15.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6593  -15.9993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3654  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6623  -16.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9469  -14.7762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0707  -15.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7764  -15.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7737  -14.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0595  -14.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3567  -14.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5315  -14.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7055  -17.2412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9982  -16.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9988  -16.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7068  -15.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2914  -15.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2921  -14.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5847  -14.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2377  -14.3703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8223  -14.3756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8192  -13.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5272  -13.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5244  -12.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8147  -11.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1062  -12.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1124  -13.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  6
  9 13  2  0
 11 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 11  1  0
  7 19  1  6
  2 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 19 27  2  0
 19 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790074

    ---

Associated Targets(Human)

GPR88 Tchem Probable G-protein coupled receptor 88 (760 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2569AlogP: 6.10#Rotatable Bonds: 11
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.09CX Basic pKa: CX LogP: 6.40CX LogD: 6.40
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -0.68

References

1. Rahman MT,Decker AM,Langston TL,Mathews KM,Laudermilk L,Maitra R,Ma W,Darcq E,Kieffer BL,Jin C.  (2020)  Design, Synthesis, and Structure-Activity Relationship Studies of (4-Alkoxyphenyl)glycinamides and Bioisosteric 1,3,4-Oxadiazoles as GPR88 Agonists.,  63  (23): [PMID:33205975] [10.1021/acs.jmedchem.0c01581]

Source