The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-Bromobenzamido)benzyl)-3-benzyloxybenzothiophene-2-carboxamide ID: ALA4790106
PubChem CID: 162670317
Max Phase: Preclinical
Molecular Formula: C30H23BrN2O3S
Molecular Weight: 571.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2ccccc2)c1)c1ccc(Br)cc1
Standard InChI: InChI=1S/C30H23BrN2O3S/c31-23-15-13-22(14-16-23)29(34)33-24-10-6-9-21(17-24)18-32-30(35)28-27(25-11-4-5-12-26(25)37-28)36-19-20-7-2-1-3-8-20/h1-17H,18-19H2,(H,32,35)(H,33,34)
Standard InChI Key: LCDLZOQBIJTJLB-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.9126 -25.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3999 -26.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6975 -26.9929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5074 -27.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7187 -25.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0208 -26.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8391 -26.4235 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.0428 -25.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3503 -25.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8025 -25.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4431 -25.8354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9215 -24.5196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2028 -25.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8434 -26.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7231 -26.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3630 -27.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1236 -27.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2407 -26.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5997 -25.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9993 -25.9363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6417 -26.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4003 -26.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0415 -26.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7996 -26.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9163 -25.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2689 -25.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5134 -25.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5255 -27.2502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2987 -24.3746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5666 -24.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5149 -23.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1981 -22.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1468 -21.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4141 -21.5686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7316 -22.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7862 -22.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6745 -25.2291 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 1 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
9 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
25 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 571.50Molecular Weight (Monoisotopic): 570.0613AlogP: 7.43#Rotatable Bonds: 8Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.21CX LogD: 7.21Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -1.42
References 1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H. (2020) Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family., 204 [PMID:32717481 ] [10.1016/j.ejmech.2020.112553 ]