N-(3-(4-Bromobenzamido)benzyl)-3-benzyloxybenzothiophene-2-carboxamide

ID: ALA4790106

PubChem CID: 162670317

Max Phase: Preclinical

Molecular Formula: C30H23BrN2O3S

Molecular Weight: 571.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2ccccc2)c1)c1ccc(Br)cc1

Standard InChI:  InChI=1S/C30H23BrN2O3S/c31-23-15-13-22(14-16-23)29(34)33-24-10-6-9-21(17-24)18-32-30(35)28-27(25-11-4-5-12-26(25)37-28)36-19-20-7-2-1-3-8-20/h1-17H,18-19H2,(H,32,35)(H,33,34)

Standard InChI Key:  LCDLZOQBIJTJLB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   15.9126  -25.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3999  -26.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6975  -26.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5074  -27.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7187  -25.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0208  -26.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8391  -26.4235    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.0428  -25.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3503  -25.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8025  -25.3280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4431  -25.8354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9215  -24.5196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2028  -25.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8434  -26.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7231  -26.8471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3630  -27.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1236  -27.0531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2407  -26.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5997  -25.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9993  -25.9363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6417  -26.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4003  -26.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0415  -26.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7996  -26.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9163  -25.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2689  -25.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5134  -25.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5255  -27.2502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2987  -24.3746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5666  -24.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5149  -23.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1981  -22.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1468  -21.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4141  -21.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7316  -22.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7862  -22.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6745  -25.2291    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 21 28  2  0
  9 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 25 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790106

    ---

Associated Targets(Human)

SENP1 Tchem Sentrin-specific protease 1 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP2 Tchem Sentrin-specific protease 2 (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP5 Tbio Sentrin-specific protease 5 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 571.50Molecular Weight (Monoisotopic): 570.0613AlogP: 7.43#Rotatable Bonds: 8
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 7.21CX LogD: 7.21
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -1.42

References

1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H.  (2020)  Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family.,  204  [PMID:32717481] [10.1016/j.ejmech.2020.112553]

Source