The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2,6-difluorobenzyl)-4-((4-oxo-6-(1H-pyrazol-4-yl)quinazolin-3(4H)-yl)methyl)benzamide ID: ALA4790114
PubChem CID: 155594116
Max Phase: Preclinical
Molecular Formula: C26H19F2N5O2
Molecular Weight: 471.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1c(F)cccc1F)c1ccc(Cn2cnc3ccc(-c4cn[nH]c4)cc3c2=O)cc1
Standard InChI: InChI=1S/C26H19F2N5O2/c27-22-2-1-3-23(28)21(22)13-29-25(34)17-6-4-16(5-7-17)14-33-15-30-24-9-8-18(10-20(24)26(33)35)19-11-31-32-12-19/h1-12,15H,13-14H2,(H,29,34)(H,31,32)
Standard InChI Key: RZEDZRWBMRVNNP-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
2.3246 -21.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3283 -22.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0387 -22.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0273 -21.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7383 -21.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7420 -22.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4545 -22.6470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1679 -22.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1642 -21.4083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4471 -20.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4423 -20.1794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8705 -20.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5796 -21.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5771 -22.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2853 -22.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9926 -22.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9872 -21.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2783 -20.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6165 -21.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5274 -20.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7278 -20.0321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3195 -20.7403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8670 -21.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7023 -22.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7062 -23.4372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4080 -22.2080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1177 -22.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8234 -22.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5309 -22.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2362 -22.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2327 -21.3812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5181 -20.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8158 -21.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1044 -20.9876 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5324 -23.4277 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
1 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 19 1 0
16 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
29 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.47Molecular Weight (Monoisotopic): 471.1507AlogP: 4.04#Rotatable Bonds: 6Polar Surface Area: 92.67Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.34CX LogP: 3.71CX LogD: 3.71Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.63
References 1. Xu G,Gaul MD,Liu Z,DesJarlais RL,Qi J,Wang W,Krosky D,Petrounia I,Milligan CM,Hermans A,Lu HR,Huang DZ,Xu JZ,Spurlino JC. (2020) Hit-to-lead optimization and discovery of a potent, and orally bioavailable G protein coupled receptor kinase 2 (GRK2) inhibitor., 30 (23): [PMID:33038544 ] [10.1016/j.bmcl.2020.127602 ]