The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(1-methyl-1H-imidazol-5-yl)-1H-1,2,3-triazol-1-yl)-N-(3-(trifluoromethoxy)phenyl)benzamide ID: ALA4790120
PubChem CID: 146294020
Max Phase: Preclinical
Molecular Formula: C20H15F3N6O2
Molecular Weight: 428.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cncc1-c1cn(-c2cccc(C(=O)Nc3cccc(OC(F)(F)F)c3)c2)nn1
Standard InChI: InChI=1S/C20H15F3N6O2/c1-28-12-24-10-18(28)17-11-29(27-26-17)15-6-2-4-13(8-15)19(30)25-14-5-3-7-16(9-14)31-20(21,22)23/h2-12H,1H3,(H,25,30)
Standard InChI Key: UMMRSRGYFUEAOD-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
15.8719 -2.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8708 -3.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5788 -3.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2885 -3.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2856 -2.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5770 -1.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9973 -3.5890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0840 -4.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8837 -4.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2912 -3.8618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7433 -3.2555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2180 -5.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8105 -6.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3583 -6.6304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1044 -6.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0176 -5.4843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6240 -4.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1627 -3.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4553 -3.1833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1621 -4.4096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4540 -4.8177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7484 -4.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0408 -4.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0398 -5.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7521 -6.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4568 -5.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7544 -6.8574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4632 -7.2640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4654 -8.0812 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0396 -6.6820 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.2501 -7.4744 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 7 1 0
4 7 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
9 12 1 0
16 17 1 0
2 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
25 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.37Molecular Weight (Monoisotopic): 428.1209AlogP: 3.82#Rotatable Bonds: 5Polar Surface Area: 86.86Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.29CX LogP: 4.26CX LogD: 4.26Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: -2.00
References 1. (2020) Triazole benzamide derivatives as gpr142 agonists,