N-Butyl-6-nitrobenzo[d]thiazol-2-amine

ID: ALA4790129

PubChem CID: 55386991

Max Phase: Preclinical

Molecular Formula: C11H13N3O2S

Molecular Weight: 251.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCNc1nc2ccc([N+](=O)[O-])cc2s1

Standard InChI:  InChI=1S/C11H13N3O2S/c1-2-3-6-12-11-13-9-5-4-8(14(15)16)7-10(9)17-11/h4-5,7H,2-3,6H2,1H3,(H,12,13)

Standard InChI Key:  COXBSNLKKNOHRN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 17 18  0  0  0  0  0  0  0  0999 V2000
   31.0105  -24.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0094  -25.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7242  -25.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7225  -24.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4378  -24.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4380  -25.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2285  -25.5044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7168  -24.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2281  -24.1598    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.5410  -24.8344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9556  -24.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7806  -24.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1953  -23.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0203  -23.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2953  -24.0084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5809  -24.4210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2951  -23.1834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 15 17  1  0
  1 15  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 251.31Molecular Weight (Monoisotopic): 251.0728AlogP: 3.42#Rotatable Bonds: 5
Polar Surface Area: 68.06Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.56CX LogP: 3.53CX LogD: 3.53
Aromatic Rings: 2Heavy Atoms: 17QED Weighted: 0.50Np Likeness Score: -2.61

References

1. Benchekroun M,Ermolenko L,Tran MQ,Vagneux A,Nedev H,Delehouzé C,Souab M,Baratte B,Josselin B,Iorga BI,Ruchaud S,Bach S,Al-Mourabit A.  (2020)  Discovery of simplified benzazole fragments derived from the marine benzosceptrin B as necroptosis inhibitors involving the receptor interacting protein Kinase-1.,  201  [PMID:32659605] [10.1016/j.ejmech.2020.112337]

Source