The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[[(2R,3S,4R,5R)-5-[4-(Benzylamino)-6-chloropyrazolo[3,4-d]-pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxyhydroxyphosphoryl]methylphosphonic Acid ID: ALA4790144
PubChem CID: 130205976
Max Phase: Preclinical
Molecular Formula: C18H22ClN5O9P2
Molecular Weight: 549.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C18H22ClN5O9P2/c19-18-22-15(20-6-10-4-2-1-3-5-10)11-7-21-24(16(11)23-18)17-14(26)13(25)12(33-17)8-32-35(30,31)9-34(27,28)29/h1-5,7,12-14,17,25-26H,6,8-9H2,(H,30,31)(H,20,22,23)(H2,27,28,29)/t12-,13-,14-,17-/m1/s1
Standard InChI Key: WSMAWKQTHDXPAT-VMUDFCTBSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
13.3969 -7.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7309 -8.7669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3008 -7.6656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6192 -7.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8801 -5.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8804 -7.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1473 -8.0539 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.5836 -8.0709 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
15.1134 -4.2721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1346 -6.0196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1672 -8.7839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8780 -4.7117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6275 -6.8445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1884 -5.1215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9670 -8.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4342 -7.6369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6849 -5.8372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4328 -6.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8699 -7.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4071 -4.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5547 -8.7709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6930 -4.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4052 -5.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9950 -8.7878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6232 -6.0239 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.1134 -3.4550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8212 -3.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6483 -8.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6975 -7.2483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5320 -3.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5368 -4.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2469 -4.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9493 -4.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9372 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2266 -3.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 12 2 0
17 14 1 0
13 4 1 0
20 22 1 0
15 3 1 0
7 21 1 0
23 20 2 0
19 7 1 0
23 10 1 0
4 15 1 1
2 7 1 0
1 4 1 0
18 13 1 0
20 9 1 0
18 17 1 1
7 16 2 0
8 19 1 0
10 5 2 0
14 22 2 0
17 23 1 0
8 24 2 0
3 8 1 0
5 12 1 0
6 1 1 0
6 18 1 0
11 8 1 0
5 25 1 0
9 26 1 0
26 27 1 0
1 28 1 6
6 29 1 6
27 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.80Molecular Weight (Monoisotopic): 549.0581AlogP: 1.05#Rotatable Bonds: 9Polar Surface Area: 209.38Molecular Species: ACIDHBA: 11HBD: 6#RO5 Violations: 3HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.98CX Basic pKa: 0.82CX LogP: -1.42CX LogD: -5.29Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.16Np Likeness Score: -0.23
References 1. Lawson KV,Kalisiak J,Lindsey EA,Newcomb ET,Leleti MR,Debien L,Rosen BR,Miles DH,Sharif EU,Jeffrey JL,Tan JBL,Chen A,Zhao S,Xu G,Fu L,Jin L,Park TW,Berry W,Moschütz S,Scaletti E,Sträter N,Walker NP,Young SW,Walters MJ,Schindler U,Powers JP. (2020) Discovery of AB680: A Potent and Selective Inhibitor of CD73., 63 (20.0): [PMID:32614585 ] [10.1021/acs.jmedchem.0c00525 ]