The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-((R)-3-(3,4-dimethoxyphenyl)-1-(((S)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carbonyl)oxy)propyl)phenoxy)acetic acid ID: ALA4790194
PubChem CID: 162668948
Max Phase: Preclinical
Molecular Formula: C31H41NO8
Molecular Weight: 555.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)(C)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1cccc(OCC(=O)O)c1
Standard InChI: InChI=1S/C31H41NO8/c1-6-31(2,3)30(36)32-17-8-7-12-24(32)29(35)40-25(22-10-9-11-23(19-22)39-20-28(33)34)15-13-21-14-16-26(37-4)27(18-21)38-5/h9-11,14,16,18-19,24-25H,6-8,12-13,15,17,20H2,1-5H3,(H,33,34)/t24-,25+/m0/s1
Standard InChI Key: DKFVOLBIGMYOBX-LOSJGSFVSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
15.1222 -19.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9394 -19.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5343 -18.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9435 -16.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9435 -17.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6488 -18.0319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3540 -17.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3540 -16.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6488 -16.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0612 -18.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0600 -18.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7695 -17.6294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4766 -18.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1849 -17.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8920 -18.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6003 -17.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3039 -18.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0118 -17.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0134 -16.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3013 -16.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5964 -16.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7187 -18.0503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7171 -18.8675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7211 -16.4138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4288 -16.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6488 -18.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3565 -19.2576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4779 -18.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7680 -19.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7664 -20.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4741 -20.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1847 -20.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1828 -19.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9411 -20.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2333 -20.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8933 -20.4834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6001 -20.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3087 -20.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0156 -20.0703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3104 -21.2976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
7 10 1 1
10 11 2 0
10 12 1 0
13 12 1 6
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
6 26 1 0
26 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
13 28 1 0
26 2 1 0
2 34 1 0
34 35 1 0
32 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.67Molecular Weight (Monoisotopic): 555.2832AlogP: 5.20#Rotatable Bonds: 13Polar Surface Area: 111.60Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.44CX Basic pKa: 0.01CX LogP: 5.59CX LogD: 2.20Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.34Np Likeness Score: -0.31
References 1. Atack TC,Raymond DD,Blomquist CA,Pasaje CF,McCarren PR,Moroco J,Befekadu HB,Robinson FP,Pal D,Esherick LY,Ianari A,Niles JC,Sellers WR. (2020) Targeted Covalent Inhibition of Plasmodium FK506 Binding Protein 35., 11 (11): [PMID:33209191 ] [10.1021/acsmedchemlett.0c00272 ]