The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl (2R,3S,5R)-2-[[(1S,3R,4R)-3,4-dideuterio-4-(3-fluorophenyl)cyclohexoxy]methyl]-3-(dimethylsulfamoylamino)-5-methyl-pyrrolidine-1-carboxylate ID: ALA4790356
PubChem CID: 154622581
Max Phase: Preclinical
Molecular Formula: C22H34FN3O5S
Molecular Weight: 471.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H][C@@H]1C[C@@H](OC[C@H]2[C@@H](NS(=O)(=O)N(C)C)C[C@@H](C)N2C(=O)OC)CC[C@@]1([2H])c1cccc(F)c1
Standard InChI: InChI=1S/C22H34FN3O5S/c1-15-12-20(24-32(28,29)25(2)3)21(26(15)22(27)30-4)14-31-19-10-8-16(9-11-19)17-6-5-7-18(23)13-17/h5-7,13,15-16,19-21,24H,8-12,14H2,1-4H3/t15-,16-,19+,20+,21+/m1/s1/i8D,16D/t8-,15-,16+,19-,20+,21+
Standard InChI Key: VRCBPPQSWQSLSW-QQQLQBHZSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
21.2098 -15.2130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6320 -15.7949 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.4249 -16.0043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4458 -18.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4458 -19.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1511 -19.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8564 -19.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8564 -18.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1511 -17.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7396 -19.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0310 -19.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3244 -19.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3252 -20.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0384 -20.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7421 -20.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5653 -17.9555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2718 -18.3662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9807 -17.9597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7252 -18.2912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2737 -17.6855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8672 -16.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0674 -17.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4612 -16.5962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0266 -15.2492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1981 -14.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0862 -17.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8938 -19.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2857 -19.6367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6707 -19.3445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4544 -20.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6163 -19.1811 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.2491 -15.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7359 -18.7706 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.7369 -17.9555 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
5 10 1 1
8 16 1 1
16 17 1 0
18 17 1 1
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
22 23 1 1
23 2 1 0
2 24 1 0
24 25 1 0
20 26 1 1
19 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
12 31 1 0
24 32 1 0
5 33 1 0
4 34 1 6
M ISO 2 33 2 34 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.60Molecular Weight (Monoisotopic): 471.2203AlogP: 2.86#Rotatable Bonds: 7Polar Surface Area: 88.18Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.41CX Basic pKa: 0.03CX LogP: 2.28CX LogD: 2.28Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.66Np Likeness Score: -0.61