N-(3-methoxyphenyl)-7-(3-methylpyridin-4-yl)-2,3-dihydrobenzo[f][1,4]oxazepine-4(5H)-carboxamide

ID: ALA4790417

PubChem CID: 162669605

Max Phase: Preclinical

Molecular Formula: C23H23N3O3

Molecular Weight: 389.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(NC(=O)N2CCOc3ccc(-c4ccncc4C)cc3C2)c1

Standard InChI:  InChI=1S/C23H23N3O3/c1-16-14-24-9-8-21(16)17-6-7-22-18(12-17)15-26(10-11-29-22)23(27)25-19-4-3-5-20(13-19)28-2/h3-9,12-14H,10-11,15H2,1-2H3,(H,25,27)

Standard InChI Key:  ZWGJSFORKCINJR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   16.5570  -29.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5559  -30.7419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2639  -31.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2621  -29.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8497  -31.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1421  -30.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4345  -31.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4334  -31.9648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1458  -32.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8504  -31.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9755  -30.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9708  -29.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6117  -29.3978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6256  -31.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4162  -29.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4286  -31.0574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7775  -30.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9449  -31.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6545  -32.4547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7516  -31.5604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2679  -32.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9748  -32.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4904  -33.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2980  -33.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5874  -32.6904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0700  -32.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3937  -32.5571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9123  -33.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5589  -32.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 11  2  0
 12  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2  5  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 13 15  1  0
 14 16  1  0
 15 17  1  0
 16 17  1  0
 16 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 25 27  1  0
 27 28  1  0
 10 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790417

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpr142 Probable G-protein coupled receptor 142 (77 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.45Molecular Weight (Monoisotopic): 389.1739AlogP: 4.49#Rotatable Bonds: 3
Polar Surface Area: 63.69Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.96CX Basic pKa: 5.66CX LogP: 3.51CX LogD: 3.50
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.72Np Likeness Score: -1.51

References

1. Wilson JE,Kurukulasuriya R,Sinz C,Lombardo M,Bender K,Parker D,Sherer EC,Costa M,Dingley K,Li X,Mitelman S,Tong S,Bugianesi R,Ehrhardt A,Priest B,Ratliff K,Ujjainwalla F,Nargund R,Hagmann WK,Edmondson S.  (2016)  Discovery and development of benzo-[1,2,4]-triazolo-[1,4]-oxazepine GPR142 agonists for the treatment of diabetes.,  26  (12.0): [PMID:27240550] [10.1016/j.bmcl.2016.04.018]

Source