The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
({2-[(2R,3S,4R,5R)-5-(6-Chloro-4-{[(2-chlorophenyl)methyl]-amino}-1H-pyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy}methyl)phosphonic Acid ID: ALA4790457
PubChem CID: 162669757
Max Phase: Preclinical
Molecular Formula: C19H22Cl2N5O7P
Molecular Weight: 534.29
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)COCC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4Cl)nc(Cl)nc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C19H22Cl2N5O7P/c20-12-4-2-1-3-10(12)7-22-16-11-8-23-26(17(11)25-19(21)24-16)18-15(28)14(27)13(33-18)5-6-32-9-34(29,30)31/h1-4,8,13-15,18,27-28H,5-7,9H2,(H,22,24,25)(H2,29,30,31)/t13-,14-,15-,18-/m1/s1
Standard InChI Key: QHXUEAYQJHERGY-ATNYBXOESA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
5.1219 -10.7473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1260 -9.9301 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.4162 -10.3351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2908 -9.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9015 -9.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3461 -9.1164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6828 -9.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9334 -10.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7547 -10.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0094 -9.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2390 -11.0411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4532 -11.0411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0413 -7.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6327 -7.8555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0413 -8.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8626 -8.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2712 -7.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8626 -7.1464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1172 -9.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4499 -9.8261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7866 -9.3460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0927 -7.8554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5011 -7.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6327 -6.4332 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.3183 -7.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7242 -7.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5406 -7.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9494 -7.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5357 -6.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7206 -6.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3084 -5.7341 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.5140 -9.6402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9058 -10.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9604 -9.1327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
6 10 1 0
9 11 1 6
8 12 1 6
7 5 1 1
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 2 0
20 21 1 0
15 21 1 0
16 19 1 0
22 23 1 0
17 22 1 0
13 24 1 0
10 21 1 1
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
30 31 1 0
4 32 1 0
32 33 1 0
33 2 1 0
2 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.29Molecular Weight (Monoisotopic): 533.0634AlogP: 1.91#Rotatable Bonds: 9Polar Surface Area: 172.08Molecular Species: ACIDHBA: 10HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.35CX Basic pKa: 1.01CX LogP: 0.14CX LogD: -1.65Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -0.47
References 1. Du X,Moore J,Blank BR,Eksterowicz J,Sutimantanapi D,Yuen N,Metzger T,Chan B,Huang T,Chen X,Chen Y,Duong F,Kong W,Chang JH,Sun J,Zavorotinskaya T,Ye Q,Junttila MR,Ndubaku C,Friedman LS,Fantin VR,Sun D. (2020) Orally Bioavailable Small-Molecule CD73 Inhibitor (OP-5244) Reverses Immunosuppression through Blockade of Adenosine Production., 63 (18): [PMID:32865411 ] [10.1021/acs.jmedchem.0c01086 ]