(3aR,4aS,9bS)-3a-(4-bromophenyl)-3,3a,4a,9b-tetrahydro-5H-indeno[1,2-d]pyrrolo[2,1-b]oxazol-1(2H)-one

ID: ALA4790470

PubChem CID: 162670094

Max Phase: Preclinical

Molecular Formula: C19H16BrNO2

Molecular Weight: 370.25

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CC[C@]2(c3ccc(Br)cc3)O[C@H]3Cc4ccccc4[C@@H]3N12

Standard InChI:  InChI=1S/C19H16BrNO2/c20-14-7-5-13(6-8-14)19-10-9-17(22)21(19)18-15-4-2-1-3-12(15)11-16(18)23-19/h1-8,16,18H,9-11H2/t16-,18-,19+/m0/s1

Standard InChI Key:  DXMFBOLVVHCUHN-YTQUADARSA-N

Molfile:  

 
     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
   33.5524  -14.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5513  -15.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2629  -16.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2611  -14.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9733  -14.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9782  -15.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7665  -15.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7587  -14.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2498  -15.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0363  -14.9347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8180  -14.3366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0068  -15.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7934  -15.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3904  -14.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1955  -14.0024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4092  -13.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6525  -15.9038    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.3417  -13.8132    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.2362  -13.8624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0307  -14.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5050  -13.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0036  -12.7601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2195  -13.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5454  -12.5633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1780  -15.0373    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  1  0
  9 10  1  0
 10 20  1  0
  8 19  1  0
 20 11  1  1
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  1  6
  8 18  1  1
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 23 24  2  0
 14 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790470

    ---

Associated Targets(Human)

HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Grin1 Glutamate NMDA receptor (6467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.25Molecular Weight (Monoisotopic): 369.0364AlogP: 3.92#Rotatable Bonds: 1
Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.13CX LogD: 4.13
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.76Np Likeness Score: 0.13

References

1. Espadinha M,Viejo L,Lopes RMRM,Herrera-Arozamena C,Molins E,Dos Santos DJVA,Gonçalves L,Rodríguez-Franco MI,Ríos CL,Santos MMM.  (2020)  Identification of tetracyclic lactams as NMDA receptor antagonists with potential application in neurological disorders.,  194  [PMID:32248004] [10.1016/j.ejmech.2020.112242]

Source