2-chloro-3-(3-chloro-4-oxocyclohexa-2,5-dienylideneamino)-2,3-dihydronaphthalene-1,4-dione

ID: ALA4790519

PubChem CID: 162668713

Max Phase: Preclinical

Molecular Formula: C16H9Cl2NO3

Molecular Weight: 334.16

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1C=C/C(=N/C2C(=O)c3ccccc3C(=O)C2Cl)C=C1Cl

Standard InChI:  InChI=1S/C16H9Cl2NO3/c17-11-7-8(5-6-12(11)20)19-14-13(18)15(21)9-3-1-2-4-10(9)16(14)22/h1-7,13-14H/b19-8-

Standard InChI Key:  QKEJQRGDAIFUOJ-UWVJOHFNSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    3.1502  -11.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1502  -12.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8623  -12.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8623  -11.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5743  -11.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5709  -12.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2796  -12.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9966  -12.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0000  -11.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2867  -11.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2890  -10.3932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2750  -13.6934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7088  -12.8776    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.7167  -11.2273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4290  -11.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4188  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1271  -12.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8461  -12.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8525  -11.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1397  -11.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5569  -12.8983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1196  -13.7095    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  7 12  2  0
  8 13  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 15 20  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 18 21  2  0
 17 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790519

    ---

Associated Targets(Human)

CTH Tchem Cystathionine gamma-lyase (128 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 334.16Molecular Weight (Monoisotopic): 332.9959AlogP: 2.74#Rotatable Bonds: 1
Polar Surface Area: 63.57Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 13.45CX Basic pKa: 1.71CX LogP: 3.23CX LogD: 3.23
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.59Np Likeness Score: 0.40

References

1. Hu Y,Wang L,Han X,Zhou Y,Zhang T,Wang L,Hong T,Zhang W,Guo XX,Sun J,Qi Y,Yu J,Liu H,Wu F.  (2019)  Discovery of a Bioactive Inhibitor with a New Scaffold for Cystathionine γ-Lyase.,  62  (3): [PMID:30562026] [10.1021/acs.jmedchem.8b01720]

Source