The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{[{[(2R,3S,4R,5R)-5-(6-Chloro-4-{[(2-chlorophenyl)methyl]-amino}-1H-pyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(methoxy)phosphoryl]methyl}phosphonic Acid ID: ALA4790529
PubChem CID: 142470829
Max Phase: Preclinical
Molecular Formula: C19H23Cl2N5O9P2
Molecular Weight: 598.27
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COP(=O)(CP(=O)(O)O)OC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4Cl)nc(Cl)nc32)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C19H23Cl2N5O9P2/c1-33-37(32,9-36(29,30)31)34-8-13-14(27)15(28)18(35-13)26-17-11(7-23-26)16(24-19(21)25-17)22-6-10-4-2-3-5-12(10)20/h2-5,7,13-15,18,27-28H,6,8-9H2,1H3,(H,22,24,25)(H2,29,30,31)/t13-,14-,15-,18-,37?/m1/s1
Standard InChI Key: GKEUAVPYIGQALX-UBTKDOLISA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
4.4244 -7.0576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8371 -7.7674 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.2455 -7.0551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8684 -7.4785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4504 -8.0605 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.6634 -7.2655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6151 -8.0244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2258 -7.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6704 -7.2467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0072 -7.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2577 -8.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0790 -8.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3337 -7.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5633 -9.1715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7776 -9.1715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3656 -5.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9570 -5.9859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3656 -6.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1869 -6.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5955 -5.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1869 -5.2768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4416 -7.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7742 -7.9565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1109 -7.4763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4170 -5.9858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8254 -5.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9570 -4.5636 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.2302 -8.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8452 -8.6084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6426 -5.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0485 -5.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8650 -5.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2737 -5.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8600 -4.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0450 -4.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6327 -3.8645 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.0627 -7.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
9 13 1 0
12 14 1 6
11 15 1 6
10 8 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
22 23 2 0
23 24 1 0
18 24 1 0
19 22 1 0
25 26 1 0
20 25 1 0
16 27 1 0
13 24 1 1
7 2 1 0
2 28 1 0
28 5 1 0
5 29 2 0
26 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
35 36 1 0
3 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.27Molecular Weight (Monoisotopic): 597.0348AlogP: 2.36#Rotatable Bonds: 10Polar Surface Area: 198.38Molecular Species: ACIDHBA: 12HBD: 5#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.57CX Basic pKa: 1.10CX LogP: -0.09CX LogD: -1.90Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.17Np Likeness Score: -0.48
References 1. Du X,Moore J,Blank BR,Eksterowicz J,Sutimantanapi D,Yuen N,Metzger T,Chan B,Huang T,Chen X,Chen Y,Duong F,Kong W,Chang JH,Sun J,Zavorotinskaya T,Ye Q,Junttila MR,Ndubaku C,Friedman LS,Fantin VR,Sun D. (2020) Orally Bioavailable Small-Molecule CD73 Inhibitor (OP-5244) Reverses Immunosuppression through Blockade of Adenosine Production., 63 (18): [PMID:32865411 ] [10.1021/acs.jmedchem.0c01086 ]