N-((4-acetamidophenyl)sulfonyl)-N-(1-(3-methoxyphenyl)indolin-4-yl)glycine

ID: ALA4790573

PubChem CID: 162671734

Max Phase: Preclinical

Molecular Formula: C24H24N2O5S

Molecular Weight: 452.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(N2CCc3c2cccc3N(CC(=O)O)S(=O)(=O)c2ccc(C)cc2)c1

Standard InChI:  InChI=1S/C24H24N2O5S/c1-17-9-11-20(12-10-17)32(29,30)26(16-24(27)28)23-8-4-7-22-21(23)13-14-25(22)18-5-3-6-19(15-18)31-2/h3-12,15H,13-14,16H2,1-2H3,(H,27,28)

Standard InChI Key:  GHEHDAVNDZITAR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   11.0492   -7.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4658   -7.2620    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.6406   -7.2574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6158   -7.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1883   -7.6778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9000   -7.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6158   -8.5028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3317   -7.2654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6852   -9.9928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2025   -9.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6850   -8.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4730   -8.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1883   -8.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9005   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8980   -9.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1852  -10.1527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4706   -9.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4258  -10.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9770  -11.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7217  -12.1744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9153  -12.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3641  -11.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6193  -10.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2730  -12.7883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0177  -13.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4416   -6.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1415   -6.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1124   -5.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3835   -4.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6836   -5.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7128   -6.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3555   -3.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  6  1  0
  4  6  1  0
  4  7  2  0
  4  8  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
  9 17  1  0
 12 17  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 24 25  1  0
 20 24  1  0
  9 18  1  0
  5 13  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 26 31  2  0
  2 26  1  0
  5  2  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790573

    ---

Associated Targets(Human)

KEAP1 Tclin Kelch-like ECH-associated protein 1 (1736 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.53Molecular Weight (Monoisotopic): 452.1406AlogP: 3.98#Rotatable Bonds: 7
Polar Surface Area: 87.15Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.36CX Basic pKa: 0.33CX LogP: 4.22CX LogD: 0.81
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -1.39

References

1. Zhou HS,Hu LB,Zhang H,Shan WX,Wang Y,Li X,Liu T,Zhao J,You QD,Jiang ZY.  (2020)  Design, Synthesis, and Structure-Activity Relationships of Indoline-Based Kelch-like ECH-Associated Protein 1-Nuclear Factor (Erythroid-Derived 2)-Like 2 (Keap1-Nrf2) Protein-Protein Interaction Inhibitors.,  63  (19.0): [PMID:32902980] [10.1021/acs.jmedchem.0c01116]

Source