6-(2-Aminoimidazolino)-6'-(guanidino)dipyridinyl-3-methane dihydrochloride

ID: ALA4790650

PubChem CID: 162670520

Max Phase: Preclinical

Molecular Formula: C15H20Cl2N8

Molecular Weight: 310.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Cl.N=C(N)Nc1ccc(Cc2ccc(NC3=NCCN3)nc2)cn1

Standard InChI:  InChI=1S/C15H18N8.2ClH/c16-14(17)22-12-3-1-10(8-20-12)7-11-2-4-13(21-9-11)23-15-18-5-6-19-15;;/h1-4,8-9H,5-7H2,(H4,16,17,20,22)(H2,18,19,21,23);2*1H

Standard InChI Key:  LLZKIEDLBSYCNW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 25  0  0  0  0  0  0  0  0999 V2000
   46.2000   -6.3643    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.4210   -3.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4199   -4.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1347   -4.7279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.8512   -4.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8483   -3.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1328   -3.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5612   -3.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2773   -3.4786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2770   -4.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9922   -4.7110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7062   -4.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7004   -3.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9846   -3.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4227   -4.7046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.1352   -4.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7050   -4.7269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9909   -4.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1310   -3.4634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.8517   -4.6974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9041   -3.4954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0973   -3.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6841   -4.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2358   -4.6509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.9054   -2.7696    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
  3 17  1  0
 17 18  1  0
 16 19  2  0
 16 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 18  1  0
M  END

Associated Targets(Human)

ADRA2A Tclin Adrenergic receptor alpha-2 (812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 310.37Molecular Weight (Monoisotopic): 310.1654AlogP: 0.74#Rotatable Bonds: 4
Polar Surface Area: 124.10Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.64CX LogP: 1.10CX LogD: 0.57
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.42Np Likeness Score: -0.39

References

1. McMullan M,Kelly B,Mihigo HB,Keogh AP,Rodriguez F,Brocos-Mosquera I,García-Bea A,Miranda-Azpiazu P,Callado LF,Rozas I.  (2021)  Di-aryl guanidinium derivatives: Towards improved α2-Adrenergic affinity and antagonist activity.,  209  [PMID:33139112] [10.1016/j.ejmech.2020.112947]

Source