4-methyl-N-(6-(2-(4-methylpiperazin-1-yl)phenyl)pyridazin-3-yl)benzenesulfonamide

ID: ALA4790669

PubChem CID: 162670778

Max Phase: Preclinical

Molecular Formula: C22H25N5O2S

Molecular Weight: 423.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)Nc2ccc(-c3ccccc3N3CCN(C)CC3)nn2)cc1

Standard InChI:  InChI=1S/C22H25N5O2S/c1-17-7-9-18(10-8-17)30(28,29)25-22-12-11-20(23-24-22)19-5-3-4-6-21(19)27-15-13-26(2)14-16-27/h3-12H,13-16H2,1-2H3,(H,24,25)

Standard InChI Key:  QHOLRPASSYCEGM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   32.4607   -3.5288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0562   -2.8230    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.6472   -3.5262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2276   -2.8354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2265   -3.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9345   -4.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6442   -3.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6413   -2.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9327   -2.4265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5203   -4.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8127   -3.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1051   -4.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1040   -4.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8164   -5.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5210   -4.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3475   -2.4205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7629   -2.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4706   -2.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1763   -2.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1736   -1.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4594   -1.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7567   -1.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8792   -1.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8148   -2.8358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5251   -2.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5285   -1.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8233   -1.2024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1131   -1.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1080   -2.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8279   -0.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  5 10  1  0
  8 16  1  0
 16  2  1  0
  2 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 11 24  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790669

    ---

Associated Targets(non-human)

Kmo Kynurenine 3-monooxygenase (34 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.54Molecular Weight (Monoisotopic): 423.1729AlogP: 3.00#Rotatable Bonds: 5
Polar Surface Area: 78.43Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.23CX Basic pKa: 7.97CX LogP: 2.13CX LogD: 2.21
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -1.60

References

1. Kimura H,Suda H,Kassai M,Endo M,Deai Y,Yahata M,Miyajima M,Isobe Y.  (2021)  N-(6-phenylpyridazin-3-yl)benzenesulfonamides as highly potent, brain-permeable, and orally active kynurenine monooxygenase inhibitors.,  33  [PMID:33359168] [10.1016/j.bmcl.2020.127753]

Source