N-Butyl-6-(3-methoxyphenyl)-1H-benzo[d]imidazol-2-amine

ID: ALA4790757

PubChem CID: 162672184

Max Phase: Preclinical

Molecular Formula: C18H21N3O

Molecular Weight: 295.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCNc1nc2ccc(-c3cccc(OC)c3)cc2[nH]1

Standard InChI:  InChI=1S/C18H21N3O/c1-3-4-10-19-18-20-16-9-8-14(12-17(16)21-18)13-6-5-7-15(11-13)22-2/h5-9,11-12H,3-4,10H2,1-2H3,(H2,19,20,21)

Standard InChI Key:  GXYSADLWTJRPAX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   20.7936  -11.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7923  -12.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5072  -13.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5054  -11.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2207  -11.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2210  -12.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0114  -12.9418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4998  -12.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0110  -11.5972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3238  -12.2718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7385  -11.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5682  -11.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0810  -11.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0823  -10.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3685  -10.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6532  -10.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6561  -11.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3703  -11.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3687   -9.3824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0833   -8.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9864  -10.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8114  -10.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  1 13  1  0
 15 19  1  0
 19 20  1  0
 12 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790757

    ---

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 295.39Molecular Weight (Monoisotopic): 295.1685AlogP: 4.45#Rotatable Bonds: 6
Polar Surface Area: 49.94Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.28CX Basic pKa: 6.94CX LogP: 4.23CX LogD: 4.11
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.66Np Likeness Score: -0.99

References

1. Benchekroun M,Ermolenko L,Tran MQ,Vagneux A,Nedev H,Delehouzé C,Souab M,Baratte B,Josselin B,Iorga BI,Ruchaud S,Bach S,Al-Mourabit A.  (2020)  Discovery of simplified benzazole fragments derived from the marine benzosceptrin B as necroptosis inhibitors involving the receptor interacting protein Kinase-1.,  201  [PMID:32659605] [10.1016/j.ejmech.2020.112337]

Source