The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-oxo-N-((1-(3-(3-oxo-3,4-dihydroquinoxalin-2-yl)propanoyl)pyrrolidin-2-yl)methyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide ID: ALA4790767
PubChem CID: 162672193
Max Phase: Preclinical
Molecular Formula: C27H28N4O4
Molecular Weight: 472.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC[C@@H]1CCCN1C(=O)CCc1nc2ccccc2[nH]c1=O)c1ccc2c(c1)CCCC2=O
Standard InChI: InChI=1S/C27H28N4O4/c32-24-9-3-5-17-15-18(10-11-20(17)24)26(34)28-16-19-6-4-14-31(19)25(33)13-12-23-27(35)30-22-8-2-1-7-21(22)29-23/h1-2,7-8,10-11,15,19H,3-6,9,12-14,16H2,(H,28,34)(H,30,35)/t19-/m0/s1
Standard InChI Key: AADFWIJPTCIDCF-IBGZPJMESA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
39.3020 -18.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0157 -18.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7215 -18.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4353 -18.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1438 -18.6707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1537 -17.0291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.4359 -17.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7261 -17.0204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8635 -17.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8546 -18.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5581 -18.6781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2709 -18.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2758 -17.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5717 -17.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5921 -18.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2982 -19.4748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6349 -19.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8838 -20.7350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7052 -20.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9653 -19.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8543 -19.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2413 -20.2427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4607 -19.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8518 -20.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2932 -19.1839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0745 -20.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4145 -21.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0239 -21.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6291 -21.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4657 -20.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6900 -20.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0725 -21.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2359 -21.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0169 -22.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1854 -22.9834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 7 1 0
5 10 1 0
9 6 1 0
6 7 1 0
7 8 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 15 2 0
1 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
17 21 1 1
21 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 30 1 0
29 27 1 0
27 28 2 0
28 24 1 0
29 30 2 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.55Molecular Weight (Monoisotopic): 472.2111AlogP: 2.80#Rotatable Bonds: 6Polar Surface Area: 112.23Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.54CX Basic pKa: 1.46CX LogP: 2.34CX LogD: 2.34Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -1.04
References 1. Lemke M,Ravenscroft H,Rueb NJ,Kireev D,Ferraris D,Franzini RM. (2020) Integrating DNA-encoded chemical libraries with virtual combinatorial library screening: Optimizing a PARP10 inhibitor., 30 (19): [PMID:32768646 ] [10.1016/j.bmcl.2020.127464 ]