1-(4-bromophenyl)-6-(2-butoxyphenyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one

ID: ALA4790858

PubChem CID: 162671391

Max Phase: Preclinical

Molecular Formula: C21H19BrN4O2

Molecular Weight: 439.31

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOc1ccccc1-c1nc2c(cnn2-c2ccc(Br)cc2)c(=O)[nH]1

Standard InChI:  InChI=1S/C21H19BrN4O2/c1-2-3-12-28-18-7-5-4-6-16(18)19-24-20-17(21(27)25-19)13-23-26(20)15-10-8-14(22)9-11-15/h4-11,13H,2-3,12H2,1H3,(H,24,25,27)

Standard InChI Key:  CVKWDOICNJSYQM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   10.9330  -13.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6472  -13.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3576  -13.8711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3576  -14.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6457  -15.1038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9330  -14.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1472  -14.9527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6629  -14.2811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1472  -13.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9321  -15.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5158  -16.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3048  -17.1312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5054  -17.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9241  -16.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1324  -15.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2904  -18.1412    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   13.0715  -15.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7857  -14.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5001  -15.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5001  -15.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7882  -16.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0715  -15.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7857  -13.8670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5037  -13.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5037  -12.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2177  -12.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2177  -11.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6472  -12.6341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  1  9  1  0
 10  7  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 13 16  1  0
 17  4  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  2 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4790858

    ---

Associated Targets(Human)

PDE5A Tclin Phosphodiesterase 5A (5113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Corpus cavernosum (27 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.31Molecular Weight (Monoisotopic): 438.0691AlogP: 4.72#Rotatable Bonds: 6
Polar Surface Area: 72.80Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.88CX Basic pKa: CX LogP: 4.74CX LogD: 4.73
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.44Np Likeness Score: -1.53

References

1. Shaaban MA,Elshaier YAMM,Hammad AH,Farag NA,Hassan Haredy H,AbdEl-Ghany AA,Mohamed KO.  (2020)  Design and synthesis of pyrazolo[3,4-d]pyrimidinone derivatives: Discovery of selective phosphodiesterase-5 inhibitors.,  30  (16): [PMID:32631538] [10.1016/j.bmcl.2020.127337]

Source