Cis-N-methyl-N-((1R,3S)-3-(5-(2-methyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)cyclohexyl)-3-(trifluoromethyl)benzamide

ID: ALA4790913

PubChem CID: 137285189

Max Phase: Preclinical

Molecular Formula: C21H23F3N6O

Molecular Weight: 432.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncc(-c2nnc([C@H]3CCC[C@@H](N(C)C(=O)c4cccc(C(F)(F)F)c4)C3)[nH]2)[nH]1

Standard InChI:  InChI=1S/C21H23F3N6O/c1-12-25-11-17(26-12)19-27-18(28-29-19)13-5-4-8-16(10-13)30(2)20(31)14-6-3-7-15(9-14)21(22,23)24/h3,6-7,9,11,13,16H,4-5,8,10H2,1-2H3,(H,25,26)(H,27,28,29)/t13-,16+/m0/s1

Standard InChI Key:  MPHWAOADWRKASJ-XJKSGUPXSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   12.7044   -7.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7044   -8.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4164   -9.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1285   -8.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1285   -7.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4164   -7.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8433   -9.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9284  -10.0545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7352  -10.2273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1487   -9.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5975   -8.8995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9700   -9.4239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5212  -10.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2754   -9.7033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1903   -8.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3835   -8.7101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9905   -9.2346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2754   -8.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5615   -9.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2742   -7.9980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9917  -10.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8490   -8.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1356   -9.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1364  -10.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8565  -10.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5669  -10.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8099   -8.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8606  -11.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5840  -11.7205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.1414  -11.7277    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.8606  -12.1405    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
  4  7  1  6
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 10 12  1  0
  2 17  1  6
 17 18  1  0
 18 19  1  0
 18 20  2  0
 17 21  1  0
 19 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 19  1  0
 15 27  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790913

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.45Molecular Weight (Monoisotopic): 432.1885AlogP: 4.32#Rotatable Bonds: 4
Polar Surface Area: 90.56Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.03CX Basic pKa: 6.09CX LogP: 2.36CX LogD: 2.27
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.18

References

1.  (2019)  Cyclohexyl benzamide compounds, 

Source