2-(5-nitrothiophen-2-yl)-N-o-tolyl-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4791008

PubChem CID: 135391732

Max Phase: Preclinical

Molecular Formula: C19H14N4O3S

Molecular Weight: 378.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1NC(=O)c1ccc2[nH]c(-c3ccc([N+](=O)[O-])s3)nc2c1

Standard InChI:  InChI=1S/C19H14N4O3S/c1-11-4-2-3-5-13(11)22-19(24)12-6-7-14-15(10-12)21-18(20-14)16-8-9-17(27-16)23(25)26/h2-10H,1H3,(H,20,21)(H,22,24)

Standard InChI Key:  SPKHZUGOOUIEQV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   33.4757   -2.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4745   -3.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1893   -4.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1875   -2.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9028   -2.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9077   -3.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6951   -3.9317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1770   -3.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6873   -2.5946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0031   -3.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4920   -3.9190    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.2750   -3.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2701   -2.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4841   -2.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9485   -4.1426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7001   -3.8026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8671   -4.9635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7598   -4.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0456   -3.6843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7591   -4.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3309   -4.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6175   -3.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9033   -4.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9022   -4.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6214   -5.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3326   -4.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6195   -2.8561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 22 27  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4791008

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.41Molecular Weight (Monoisotopic): 378.0787AlogP: 4.76#Rotatable Bonds: 4
Polar Surface Area: 100.92Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.78CX Basic pKa: 3.29CX LogP: 4.77CX LogD: 4.77
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.39Np Likeness Score: -2.06

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source