N-(3-Benzamidobenzyl)-3-(3-nitrobenzyloxy)benzothiophene-2-carboxamide

ID: ALA4791044

PubChem CID: 162671872

Max Phase: Preclinical

Molecular Formula: C30H23N3O5S

Molecular Weight: 537.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2cccc([N+](=O)[O-])c2)c1)c1ccccc1

Standard InChI:  InChI=1S/C30H23N3O5S/c34-29(22-10-2-1-3-11-22)32-23-12-6-8-20(16-23)18-31-30(35)28-27(25-14-4-5-15-26(25)39-28)38-19-21-9-7-13-24(17-21)33(36)37/h1-17H,18-19H2,(H,31,35)(H,32,34)

Standard InChI Key:  HGHIDBNTOMZSTP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   30.1758  -10.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6581  -11.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9585  -12.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7761  -12.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9894  -10.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2944  -11.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1206  -11.4630    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.3261  -10.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6271  -10.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0931  -10.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7398  -10.8693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2133   -9.5410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5067  -10.5652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1535  -11.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0319  -11.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6779  -12.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4457  -12.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5639  -11.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9170  -10.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3298  -10.9711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9783  -11.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7441  -11.1742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3914  -11.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1567  -11.3823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2745  -10.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6210  -10.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8584  -10.3634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8610  -12.2975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5750   -9.3946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8359   -9.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7837   -8.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4734   -7.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4216   -6.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6820   -6.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9930   -7.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0481   -7.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1096   -6.4695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8486   -6.8364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0579   -5.6462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 21 28  2  0
  9 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 37 38  1  0
 37 39  2  0
 33 37  1  0
M  CHG  2  37   1  38  -1
M  END

Alternative Forms

  1. Parent:

    ALA4791044

    ---

Associated Targets(Human)

SENP1 Tchem Sentrin-specific protease 1 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP2 Tchem Sentrin-specific protease 2 (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP5 Tbio Sentrin-specific protease 5 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.60Molecular Weight (Monoisotopic): 537.1358AlogP: 6.57#Rotatable Bonds: 9
Polar Surface Area: 110.57Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.38CX LogD: 6.38
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.16Np Likeness Score: -1.60

References

1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H.  (2020)  Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family.,  204  [PMID:32717481] [10.1016/j.ejmech.2020.112553]

Source